Introduction：Basic information about 2,7-diphenyl-9H-Fluoren-9-one CAS 115033-91-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,7-diphenyl-9H-Fluoren-9-one Basic information
| Product Name: | 2,7-diphenyl-9H-Fluoren-9-one |
| Synonyms: | 2,7-diphenyl-9H-Fluoren-9-one;9H-Fluoren-9-one, 2,7-diphenyl- |
| CAS: | 115033-91-5 |
| MF: | C25H16O |
| MW: | 332.39 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 115033-91-5.mol |
|
2,7-diphenyl-9H-Fluoren-9-one Chemical Properties
| Melting point | 235.3 °C(Solv: dichloromethane (75-09-2); ligroine (8032-32-4)) |
| Boiling point | 581.2±30.0 °C(Predicted) |
| density | 1.206±0.06 g/cm3(Predicted) |
| InChI | InChI=1S/C25H16O/c26-25-23-15-19(17-7-3-1-4-8-17)11-13-21(23)22-14-12-20(16-24(22)25)18-9-5-2-6-10-18/h1-16H |
| InChIKey | JHPVZYUJSQWUBP-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(C3=CC=CC=C3)=C2)C2=C1C=C(C1=CC=CC=C1)C=C2 |
Safety Information
2,7-diphenyl-9H-Fluoren-9-one Usage And Synthesis
2,7-diphenyl-9H-Fluoren-9-one Preparation Products And Raw materials
| Raw materials | 2,7-DIIODO-FLUOREN-9-ONE-->Phenylboronic acid-->2,7-Dibromo-9H-fluoren-9-one |
