Introduction:Basic information about 2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol CAS 16156-94-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol Basic information
| Product Name: | 2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol |
| Synonyms: | Ethanol,2-[2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethoxy]-;Metronidazole impurity 4/Metronidazole EP impurity F/2-(2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethoxy)ethan-1-ol;2-[2-(2-Methyl-5-nitro-1H-iMidazol-1-yl)ethoxy]ethanol;2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol;Metronidazole IMpurity F;O-Hydroxyethyl Metronidazole;Metronidazole EP Impurity F;Metronidazole impurity F (EP) |
| CAS: | 16156-94-8 |
| MF: | C8H13N3O4 |
| MW: | 215.21 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 16156-94-8.mol |
|
2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol Chemical Properties
| Melting point | 75 - 77°C |
| Boiling point | 449.9±30.0 °C(Predicted) |
| density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 14.37±0.10(Predicted) |
| color | White to Pale Yellow |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C8H13N3O4/c1-7-9-6-8(11(13)14)10(7)2-4-15-5-3-12/h6,12H,2-5H2,1H3 |
| InChIKey | UGPDZGBXWBKFMT-UHFFFAOYSA-N |
| SMILES | C(O)COCCN1C(C)=NC=C1[N+]([O-])=O |
Safety Information
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |
2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol Usage And Synthesis
| Uses | O-Hydroxyethyl Metronidazole is the hydroxy ethyl analogue and impurity of the antiprotozoal agent Metronidazole (M338880). O-Hydroxyethyl Metronidazole as well as other 1-substituted-2-methyl-5-nitroimidazoles showed potential antitrichomonal activity. |
2-[2-(2-Methyl-5-nitroiMidazol-1-yl)ethoxy]ethanol Preparation Products And Raw materials