Introduction：Basic information about 2-Benzylaniline CAS 28059-64-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Benzylaniline Basic information
| Product Name: | 2-Benzylaniline |
| Synonyms: | o-Aminodiphenylmethane;o-Benzylaniline;o-Toluidine, alpha-phenyl-;2-BENZYLANILINE;2-(PHENYLMETHYL)BENZENAMINE;2-AMINODIPHENYLMETHANE;2-BENZYLANILINE, 99+%;2-Benzylphenylamine |
| CAS: | 28059-64-5 |
| MF: | C13H13N |
| MW: | 183.25 |
| EINECS: | 248-806-3 |
| Product Categories: | |
| Mol File: | 28059-64-5.mol |
|
2-Benzylaniline Chemical Properties
| Melting point | 49-54 °C (lit.) |
| Boiling point | 172-173 °C/12 mmHg (lit.) |
| density | 1.0650 (rough estimate) |
| refractive index | 1.5963 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.29±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 2803264 |
| InChI | InChI=1S/C13H13N/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9H,10,14H2 |
| InChIKey | DWOBGCPUQNFAFB-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC=C1CC1=CC=CC=C1 |
| CAS DataBase Reference | 28059-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2-(phenylmethyl)-(28059-64-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-Benzylaniline Usage And Synthesis
| Uses | 2-Benzylaniline was used to study efficient and convenient heterogeneous palladium-catalyzed regioselective deuteration at the benzylic position. |
2-Benzylaniline Preparation Products And Raw materials
| Preparation Products | 6-(Phthalimidomethyl)morphanthridine-->6-Chloromethylmorphanthridine-->N-[2-(Phenylmethyl)phenyl]-2-chloroacetamide-->EPINASTINE HYDROCHLORIDE |
