Introduction：Basic information about 2-Bromo-5-fluorophenol CAS 147460-41-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-5-fluorophenol Basic information
| Product Name: | 2-Bromo-5-fluorophenol |
| Synonyms: | 2-BROMO-5-FLUOROPHENOL;Phenol, 2-bromo-5-fluoro-;2-Bromo-5-fluorophenol 98%;2-Bromo-5-fluorophenol98%;2-BROMO-5-FLUOROPHENOL 0.99 COLORLESS TRANSPARENT LIQUID;2-Bromo-5-fluorophenol,97%;2-Bromo-5-fluorophenol,99%;2-Bromo-5-fluorophenol,96% |
| CAS: | 147460-41-1 |
| MF: | C6H4BrFO |
| MW: | 191 |
| EINECS: | 604-585-9 |
| Product Categories: | Aromatic Phenols;Fluorobenzene;Phenol&Thiophenol&Mercaptan;Bromine Compounds;Fluorine Compounds;Phenols;Organic Building Blocks;Oxygen Compounds |
| Mol File: | 147460-41-1.mol |
|
2-Bromo-5-fluorophenol Chemical Properties
| Boiling point | 185°C |
| density | 1.717 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.553(lit.) |
| Fp | 189 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 7.43±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.717 |
| BRN | 7915214 |
| InChI | InChI=1S/C6H4BrFO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H |
| InChIKey | HUVAOAVBKOVPBZ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC=C1Br |
| CAS DataBase Reference | 147460-41-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-Bromo-5-fluorophenol Usage And Synthesis
| Chemical Properties | Colorless liquid |
| Uses | 2-Bromo-5-fluorophenol may be used for the preparation of reaction intermediates required for the synthesis of polycyclic 5-HT3 and 5-HT4 antagonists. It may be used for the the nucleophilic substitution of the 2,2′,4,4′-tetrabromodiphenyl iodonium chloride (iodyl salt). |
| General Description | 2-Bromo-5-fluorophenol an aryl fluorinated building block. |
2-Bromo-5-fluorophenol Preparation Products And Raw materials
| Preparation Products | 4-Bromo-3-fluorophenol-->2-(benzyloxy)-1-broMo-4-fluorobenzene-->2-bromo-5-fluorobenzenethiol-->MK8245 |
