Introduction：Basic information about 2-Bromo-5-methylbenzonitrile CAS 42872-83-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-5-methylbenzonitrile Basic information
| Product Name: | 2-Bromo-5-methylbenzonitrile |
| Synonyms: | Benzonitrile, 2-bromo-5-methyl-;6-BROMO-M-TOLUNITRILE;2-BROMO-5-METHYLBENZONITRILE;5-methyl-2-Bromobenzonitrile;4-Bromo-3-cyanotoluene;Benzonitrile, 2-bromo-5-methyl- (9CI);m-Tolunitrile, 6-bromo- (4CI);4-Bromo-3-cyanotoluene, 6-Bromo-m-tolunitrile |
| CAS: | 42872-83-3 |
| MF: | C8H6BrN |
| MW: | 196.04 |
| EINECS: | |
| Product Categories: | C8 to C9;Cyanides/Nitriles;Aromatic Nitriles;Nitrogen Compounds;Aromatic |
| Mol File: | 42872-83-3.mol |
|
2-Bromo-5-methylbenzonitrile Chemical Properties
| Melting point | 61-65 °C |
| Boiling point | 290 °C |
| density | 1.51 |
| Fp | 129 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to pale yellow |
| InChI | InChI=1S/C8H6BrN/c1-6-2-3-8(9)7(4-6)5-10/h2-4H,1H3 |
| InChIKey | AKCXJAVATJLYQM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C)=CC=C1Br |
| CAS DataBase Reference | 42872-83-3 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
2-Bromo-5-methylbenzonitrile Usage And Synthesis
| Chemical Properties | off-white crystalline |
| Reactions | 2-Bromo-5-methylbenzonitrile is a quinazolinone that can be synthesized by reacting 2-bromotoluene with nitric acid. It is a substrate for the synthesis of other quinazolinones. |
2-Bromo-5-methylbenzonitrile Preparation Products And Raw materials
| Raw materials | 2-Bromo-5-methylbenzenamine-->4-Bromo-3-nitrotoluene-->m-Tolunitrile-->4-Methyl-2-nitroaniline |
