Introduction：Basic information about 2-Bromo-6-nitrophenol CAS 13073-25-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-6-nitrophenol Basic information
| Product Name: | 2-Bromo-6-nitrophenol |
| Synonyms: | TIMTEC-BB SBB008567;2-Bromo-6-nitropheno;3-Bromo-2-hydroxynitrobenzene;2-BROMO-6-NITROPHENOL;6-NITRO-2-BROMOPHENOL;Phenol, 2-broMo-6-nitro-;6-BroMo-2-nitrophenol;2-BroMo-6-nitrophenol, 97+% |
| CAS: | 13073-25-1 |
| MF: | C6H4BrNO3 |
| MW: | 218 |
| EINECS: | 629-309-4 |
| Product Categories: | Fluorobenzene;Aromatic Phenols;Phenol&Thiophenol&Mercaptan;Organic Building Blocks;Oxygen Compounds;Phenols |
| Mol File: | 13073-25-1.mol |
|
2-Bromo-6-nitrophenol Chemical Properties
| Melting point | 66-70 °C (lit.) |
| Boiling point | 227.2±20.0 °C(Predicted) |
| density | 1.881±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform; Methanol |
| pka | 5.36±0.24(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C6H4BrNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
| InChIKey | VEJSIOPQKQXJAT-UHFFFAOYSA-N |
| SMILES | C1(O)=C([N+]([O-])=O)C=CC=C1Br |
| CAS DataBase Reference | 13073-25-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Bromo-6-nitrophenol (13073-25-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36/37-26 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
2-Bromo-6-nitrophenol Usage And Synthesis
| Chemical Properties | White solid |
| Uses | 2-Bromo-6-nitrophenol is an intermediate used in the synthesis of N-Hydroxy Eltrombopag (H825795), which is a derivative compound of Eltrombopag (508000), an agonist of the Thrombopoietin (Tpo) receptor, used as treatment for thrombocytopenia. |
2-Bromo-6-nitrophenol Preparation Products And Raw materials
| Raw materials | 1-Bromo-2-nitrobenzene-->3-Bromo-2-nitrophenol-->3-Bromo-4-nitrophenol-->1-Bromo-2-methoxy-3-nitro-benzene-->2-Bromo-4-nitrophenol-->Piperidine-->2-Nitrophenol |
| Preparation Products | 3''-AMINO-2''-HYDROXY-BIPHENYL-3-CARBOXYLIC ACID-->2,4-DIBROMO-6-NITROPHENOL-->2-Bromo-3-nitrophenol-->4-Bromo-2-nitrophenol |
