Introduction：Basic information about 2-Bromo-9,10-diphenylanthracene CAS 201731-79-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromo-9,10-diphenylanthracene Basic information
| Product Name: | 2-Bromo-9,10-diphenylanthracene |
| Synonyms: | Anthracene,2-broMo-9,10-diphenyl-;2-Bromo-9,10-diphenylanthracene;2-broMo-9,10-diphenyl-9,10-dihydroanthracene;2BrPAn;2 - bromine - 9.10 - diphenyl anthracene;2-Bromo-9,10-diphenylanthracene >2-Bromo-9,10-diphenylanthracene ISO 9001：2015 REACH;DKIK1 |
| CAS: | 201731-79-5 |
| MF: | C26H17Br |
| MW: | 409.32 |
| EINECS: | 1312995-182-4 |
| Product Categories: | OLED |
| Mol File: | 201731-79-5.mol |
|
2-Bromo-9,10-diphenylanthracene Chemical Properties
| Melting point | 185.0 to 189.0 °C |
| Boiling point | 508.6±19.0 °C(Predicted) |
| density | 1.344 |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C26H17Br/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17H |
| InChIKey | OZNXPZBQVNNJCS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(C3=CC=CC=C3)=C3C(=C2C2=CC=CC=C2)C=CC=C3)=CC=C1Br |
Safety Information
2-Bromo-9,10-diphenylanthracene Usage And Synthesis
| Uses | 2-Bromo-9,10-diphenylanthracene is a blue fluorescent agent frequently used in chemiluminescence and is a novel type of agricultural blue light conversion material. |
2-Bromo-9,10-diphenylanthracene Preparation Products And Raw materials
