Introduction:Basic information about 2-Bromobenzoyl chloride CAS 7154-66-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Bromobenzoyl chloride Basic information
| Product Name: | 2-Bromobenzoyl chloride |
| Synonyms: | O-BROMOBENZOYL CHLORIDE;2-BROMOBENZOYL CHLORIDE;2-BROMOBENZENE-1-CARBONYL CHLORIDE;o-bromo-benzoylchlorid;2-BromobenzoyL;Benzoyl chloride, 2-bromo-;2-Bromobenzoic acid chloride;2-Bromobenzoyl chloride,98% |
| CAS: | 7154-66-7 |
| MF: | C7H4BrClO |
| MW: | 219.46 |
| EINECS: | 230-507-4 |
| Product Categories: | Aromatic Halides (substituted);Acid Halides;Carbonyl Compounds;Organic Building Blocks |
| Mol File: | 7154-66-7.mol |
|
2-Bromobenzoyl chloride Chemical Properties
| Melting point | 8-10 °C(lit.) |
| Boiling point | 245 °C(lit.) |
| density | 1.679 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.597(lit.) |
| Fp | >230 °F |
| storage temp. | 0-6°C |
| solubility | soluble in Chloroform, Methanol |
| form | Liquid |
| Specific Gravity | 1.680 |
| color | Clear colorless to light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 508506 |
| InChI | InChI=1S/C7H4BrClO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H |
| InChIKey | NZCKTGCKFJDGFD-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1Br |
| CAS DataBase Reference | 7154-66-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromobenzoyl chloride(7154-66-7) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6635000 |
| F | 8-10-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
2-Bromobenzoyl chloride Usage And Synthesis
| Chemical Properties | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID |
| Uses | 2-Bromobenzoyl chloride is used in synthetic chemistry as an acylating agent. 2-Bromobenzoyl chloride is also used as a reagent to synthesize fluorazone, a heteroaromatic compound that exhibits antidiabetic, psychostimulant and anticancer activity. |
2-Bromobenzoyl chloride Preparation Products And Raw materials
| Preparation Products | Methyl 2-bromobenzoate-->2-(2-Bromophenyl)-2-propanol-->Ethyl 2-bromobenzoate-->N-(2-bromobenzyl)-N-butyl-N-methylamine-->2-BROMO-4'-ETHOXYBENZOPHENONE-->5-(2-BROMOPHENYL)-5-OXOVALERONITRILE-->2-bromo-N-(2-methoxyphenyl)benzamide-->2-Bromo-N-(4-fluorophenyl)benzenesulfonamide, 97%-->2-Bromo-N,N-diisopropylbenzamide-->2-Bromo-N-butylbenzamide |