Introduction：Basic information about 2-Fluoro-3-methylaniline CAS 1978-33-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Fluoro-3-methylaniline Basic information
| Product Name: | 2-Fluoro-3-methylaniline |
| Synonyms: | 2-FLUORO-M-TOLUIDINE;2-FLUORO-3-METHYLANILINE;3-AMINO-2-FLUOROTOLUENE;3-AMINO-2-FLUOROTOLUENE, 98+%;2-FLUORO-3-METHYLBENZENAMINE;3-Amino-2-fluorotoluene, 2-Fluoro-m-toluidine;2-Fluoro-m-toluidine3-Amino-2-fluorotoluene;Benzenamine, 2-fluoro-3-methyl- |
| CAS: | 1978-33-2 |
| MF: | C7H8FN |
| MW: | 125.14 |
| EINECS: | |
| Product Categories: | Anilines, Aromatic Amines and Nitro Compounds;Aniline series;Aniline;Halogen toluene;Fluorin-contained toluene series |
| Mol File: | 1978-33-2.mol |
|
2-Fluoro-3-methylaniline Chemical Properties
| Boiling point | 87 °C / 12mmHg |
| density | 1.11 |
| refractive index | 1.5360 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | liquid |
| pka | 3.33±0.10(Predicted) |
| color | clear, very dark red |
| InChI | InChI=1S/C7H8FN/c1-5-3-2-4-6(9)7(5)8/h2-4H,9H2,1H3 |
| InChIKey | WFZUBZAEFXETBF-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(C)=C1F |
| CAS DataBase Reference | 1978-33-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2810 |
| HazardClass | IRRITANT, TOXIC |
| HazardClass | 6.1 |
| HS Code | 2921420090 |
2-Fluoro-3-methylaniline Usage And Synthesis
2-Fluoro-3-methylaniline Preparation Products And Raw materials
| Raw materials | 2-Fluoro-3-nitrotoluene |
| Preparation Products | Hydrazine, (2-fluoro-3-methylphenyl)- |
