Introduction：Basic information about 2-Fluoro-4-bromonitrobenzene CAS 321-23-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Fluoro-4-bromonitrobenzene Basic information
| Product Name: | 2-Fluoro-4-bromonitrobenzene |
| Synonyms: | 1-BROMO-3-FLUORO-4-NITROBENZENE;4-BROMO-2-FLUORONITROBENZENE;4-BROMO-2-FLUORO-1-NITRO-BENZENE;2-FLUORO-4-BROMONITROBENZENE;4-Bromo-2-fluoronitrobenzene 97%;1-Bromo-3-fluoro-4-nitrobenzene4-Bromo-2-fluoronitrobenzene;4-Bromo-2-fluoronitrobenzene ,97%;4-bromo-2-fluoro-1-nitrobenzene(SALTDATA: FREE) |
| CAS: | 321-23-3 |
| MF: | C6H3BrFNO2 |
| MW: | 220 |
| EINECS: | 628-505-7 |
| Product Categories: | Fluorine series;API intermediates;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 321-23-3.mol |
|
2-Fluoro-4-bromonitrobenzene Chemical Properties
| Melting point | 83-86 |
| Boiling point | 263.2±20.0 °C(Predicted) |
| density | 1.375 |
| Fp | 86℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | Pale yellow to orange |
| InChI | InChI=1S/C6H3BrFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChIKey | VQCWSOYHHXXWSP-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 321-23-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
2-Fluoro-4-bromonitrobenzene Usage And Synthesis
| Chemical Properties | White to orange to brown solid |
| Uses | Building block for fused aromatic and heteroaromatic compounds |
2-Fluoro-4-bromonitrobenzene Preparation Products And Raw materials
| Preparation Products | 3-Fluoro-4-nitrophenylboronic acid,pinacol ester-->2(1H)-Quinoxalinone, 6-broMo-3,4-dihydro--->6-BROMO-1-METHYL-1H-BENZO[D]IMIDAZOLE-->4-bromo-2-methoxy-1-nitrobenzene-->2-Bromo-4-fluoronitrobenzene-->ISIBNKKIJOEHIW-UHFFFAOYSA-N |
