Introduction:Basic information about 2-Fluoro-6-nitrotoluene CAS 769-10-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Fluoro-6-nitrotoluene Basic information
| Product Name: | 2-Fluoro-6-nitrotoluene |
| Synonyms: | 2-FLUORO-6-NITROTOLUENE;2-Fluoro-6-nitrotoluene 98%;2-Fluoro-6-nitrotoluene98%;1-FLUORO-2-METHYL-3-NITRO-BENZENE;1-FLUOR-2-METHYL-3-NITROBENZENE;2-methyl-3-fluoronitrobenzene;2-NITRO-6-FLUOROTOLUENE;2-Fluoro-6-nitrotluene |
| CAS: | 769-10-8 |
| MF: | C7H6FNO2 |
| MW: | 155.13 |
| EINECS: | 212-203-3 |
| Product Categories: | Fluorinated benzene series;Halogen toluene;Aromatic Hydrocarbons (substituted) & Derivatives;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Fluorides;Fluorin-contained toluene series |
| Mol File: | 769-10-8.mol |
|
2-Fluoro-6-nitrotoluene Chemical Properties
| Melting point | 6.5-7 °C (lit.) |
| Boiling point | 97 °C/11 mmHg (lit.) |
| density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.523(lit.) |
| Fp | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| Specific Gravity | 1.270 |
| BRN | 2361978 |
| InChI | InChI=1S/C7H6FNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | GXPIVRKDWZKIKZ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 769-10-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-28A-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
2-Fluoro-6-nitrotoluene Usage And Synthesis
| Chemical Properties | colorless to light yellow liqui |
| Uses | 1-Fluoro-2-methyl-3-nitrobenzene |
| Uses | 2-Fluoro-6-nitrotoluene has been used in the preparation of 4-fluoroindole via Leimgruber-Batcho procedure. |
| General Description | 2-Fluoro-6-nitrotoluene undergoes reduction in the presence of stannous chloride, followed by benzoylation to yield N-(3-fluoro-o-tolyl)benzamide. 2-Fluoro-6-nitrotoluene undergoes reaction with concentrated nitric acid at 100°C to yield 2-fluoro-6-nitrobenzoic acid. |
2-Fluoro-6-nitrotoluene Preparation Products And Raw materials
| Preparation Products | 5-FLUORO-2H-3,1-BENZOXAZINE-2,4(1H)-DIONE-->4-Fluoroindole-->2-Fluoro-5-nitrotoluene-->2-Fluoro-6-nitrobenzoic acid-->3-Fluoro-2-methylphenol-->4-FLUORO (1H)INDAZOLE |