Introduction：Basic information about 2-Fluorobenzyl bromide CAS 446-48-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Fluorobenzyl bromide Basic information
| Product Name: | 2-Fluorobenzyl bromide |
| Synonyms: | α-Bromo-2-fluorotoluene;2-fluoro(bromomethyl)benzene;2-FLUOROBENZYL BROMIDE 98%;2-Fluorobenzylbromide,98%;ALPHA-BROMO-O-FLUOROTOLUENE;à-bromo-2-fluorotoluene;2-Fluorobenzyl broMide, 98% 25GR;2-Fluorobenzyl broMide, 98% 5GR |
| CAS: | 446-48-0 |
| MF: | C7H6BrF |
| MW: | 189.02 |
| EINECS: | 207-169-1 |
| Product Categories: | Benzyl;Fluoro-contained benzyl bromide series;1;bc0001 |
| Mol File: | 446-48-0.mol |
|
2-Fluorobenzyl bromide Chemical Properties
| Boiling point | 84-85 °C15 mm Hg(lit.) |
| density | 1.567 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.552(lit.) |
| Fp | 181 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.567 |
| color | Clear colorless to slightly yellow |
| Sensitive | Lachrymatory |
| BRN | 1099894 |
| InChI | InChI=1S/C7H6BrF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | FFWQLZFIMNTUCZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1F |
| CAS DataBase Reference | 446-48-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Fluorobenzyl bromide(446-48-0) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 23-26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B
STOT SE 3 |
2-Fluorobenzyl bromide Usage And Synthesis
| Chemical Properties | clear colorless to slightly yellow liquid |
| Uses | 2-Fluorobenzyl bromide was used:
- in the synthesis of 2-pyrrolo[2,3-d]pyrimidines
- as alkylating agent during the synthesis of 8-alkylated imidazolo[1,2-a]pyrimid-5-ones
- in the synthesis of prasugrel
|
2-Fluorobenzyl bromide Preparation Products And Raw materials
| Preparation Products | ETHYL 2-FLUOROPHENYLACETATE-->(2-FLUORO-PHENYL)-METHANESULFONYL CHLORIDE-->2-BROMOMETHYL-1-FLUORO-4-NITROBENZENE-->Cyclopropyl 2-fluorobenzyl ketone-->2-FLUORO-DL-PHENYLALANINE-->(2-FLUORO-BENZYL)-HYDRAZINE-->1-(2-fluorobenzyl)piperidin-4-ol-->N-Benzyl-2-fluoro-N-MethylbenzylaMine, 97%-->Benzenemethanamine, 2-fluoro-N-[(4-fluorophenyl)methyl]-N-methyl--->2-FLUOROBENZYLMETHYLSULFONE-->1-[(2-FLUOROPHENYL)METHYL]-1H-INDOLE-2,3-DIONE-->Benzene, 2-chloro-1-[(2-fluorophenyl)methoxy]-4-nitro--->2-Fluorobenzylboronic acid pinacol ester |
