Introduction：Basic information about 2-mercapto-N-methylbenzamide CAS 20054-45-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-mercapto-N-methylbenzamide Basic information
| Product Name: | 2-mercapto-N-methylbenzamide |
| Synonyms: | N-methyl-2-sulfanylbenzamide;BenzaMide, 2-Mercapto-N-Methyl-;2- Mercapto-N-MethyllbenzaMide;2-MERCAPTO-N-METHYL BENZAMIDE(RE-EXPORTWIDE B/E.NO:2513786 DT 08.09.2015);N-methyl-2-sulfanylbenzamide ISO 9001：2015 REACH;1.2-mercapto-N-methylbenzamide;Axitinib 2-Mercapto N-Methyl Benzamide;TIANFU CHEM N-methyl-2-sulfanylbenzamide |
| CAS: | 20054-45-9 |
| MF: | C8H9NOS |
| MW: | 167.23 |
| EINECS: | 633-825-5 |
| Product Categories: | Intermediate |
| Mol File: | 20054-45-9.mol |
|
2-mercapto-N-methylbenzamide Chemical Properties
| Melting point | 94-96 °C |
| Boiling point | 326.2±25.0 °C(Predicted) |
| density | 1.174 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.89±0.43(Predicted) |
| color | Off-White to Pale Beige |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C8H9NOS/c1-9-8(10)6-4-2-3-5-7(6)11/h2-5,11H,1H3,(H,9,10) |
| InChIKey | VIFOAZNEQRHREM-UHFFFAOYSA-N |
| SMILES | C(NC)(=O)C1=CC=CC=C1S |
| LogP | 1.360 (est) |
Safety Information
2-mercapto-N-methylbenzamide Usage And Synthesis
| Description | N-methyl-2-sulfanylbenzamide is an axitinib intermediate. |
| Uses | 2-Mercapto-N-methyl-benzamide is an intermediate used to prepare axitinib (A794650) which is a tyrosine kinase inhibitor. Axitinib is used in cancer therapy. |
| Application | 2-Mercapto-N-methyl-benzamide is an intermediate used to prepare axitinib which is a tyrosine kinase inhibitor. Axitinib is used in cancer therapy. |
| Synthesis | 2-mercapto-N-methylbenzamide is prepared by reactig 2,2'-Disulfanediylbis(N-methylbenzamide) and sodium tetrahydroborate In tetrahydrofuran.
|
2-mercapto-N-methylbenzamide Preparation Products And Raw materials
| Preparation Products | Axitinib Impurity B-->BenzaMide, 2-[(3-iodo-1H-indazol-6-yl)thio]-N-Methyl- |
