Introduction:Basic information about 2-Naphthylacetic acid CAS 581-96-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Naphthylacetic acid Basic information
| Product Name: | 2-Naphthylacetic acid |
| Synonyms: | LABOTEST-BB LT00408955;AKOS BBS-00007768;beta.-Naphthaleneacetate;beta-naphthaleneacetate;Betoxan;Naphthalen-2-yl-aceticacid;2-NAPHTHYLACETIC ACID 97%;b-NaphthylaceticAcid |
| CAS: | 581-96-4 |
| MF: | C12H10O2 |
| MW: | 186.21 |
| EINECS: | 209-475-0 |
| Product Categories: | Building Blocks;C11 to C12;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Pharmaceutical Raw Materials;Organic acids;Naphthalene derivatives;Organic Building Blocks;Naphthalene series |
| Mol File: | 581-96-4.mol |
|
2-Naphthylacetic acid Chemical Properties
| Melting point | 141-143 °C (lit.) |
| Boiling point | 280.69°C (rough estimate) |
| density | 1.1032 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: 50 mg/mL, clear |
| pka | pK1:4.256 (25°C) |
| form | Crystalline Powder or Flakes |
| color | White to almost white |
| Water Solubility | insoluble |
| BRN | 973396 |
| InChI | InChI=1S/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14) |
| InChIKey | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CC(O)=O |
| CAS DataBase Reference | 581-96-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthaleneacetic acid(581-96-4) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | QJ0876000 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
2-Naphthylacetic acid Usage And Synthesis
| Chemical Properties | WHITE TO ALMOST WHITE CRYST. POWDER OR FLAKES |
| Uses | 2-Naphthylacetic acid can be used to synthesize hydrolase inhibitors. It can also be utilized for developing?γ-dipeptide derivatives that can bind human somatostatin receptors. |
| Definition | ChEBI: 2-naphthylacetic acid is a naphthylacetic acid carrying a carboxy group at position 2. |
| Purification Methods | Crystallise the acid from water or *benzene. [Beilstein 9 H 666, 9 IV 2431.] |
2-Naphthylacetic acid Preparation Products And Raw materials
| Raw materials | 1-Naphthaleneacetic acid |
| Preparation Products | 2-(2-Naphthyl)acetyl chloride-->2-Naphthaleneacetamide, N-hydroxy--->2-Naphthylacetonitrile |