Introduction：Basic information about 3-(4-Fluorophenyl)-1-isopropyl-1H-indole CAS 93957-49-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-(4-Fluorophenyl)-1-isopropyl-1H-indole Basic information
| Product Name: | 3-(4-Fluorophenyl)-1-isopropyl-1H-indole |
| Synonyms: | 3-(4-Fluoro-phenyl)-1-Isopropyl-1H-Indol;3-(4- fluorinephenyl)-1- isopropyl-1H- indole;1-Isopropyl-3-(4-flrorophenyl)-indole;1-ISOPROPYL-3-(4-FLUOROPHENYL)INDOLE;1-ISOPROPYL-3-(4-FLUOROROPHENYL)-INDOLE;(4-FLUOROPHENYL)-1-ISOPROPYL-3-INDOLE;3-(4-FLUOROPHENYL)-1-(1-METHYLETHYL)-1H-INDOLE;3-(4-FLUOROPHENYL)-1-ISOPROPYL-1H-INDOLE |
| CAS: | 93957-49-4 |
| MF: | C17H16FN |
| MW: | 253.31 |
| EINECS: | 418-790-4 |
| Product Categories: | Fluvastatine;Aromatics;Indole Derivatives;Indoles and derivatives;Indole;Aromatics Compounds;Fluvastatin |
| Mol File: | 93957-49-4.mol |
|
3-(4-Fluorophenyl)-1-isopropyl-1H-indole Chemical Properties
| Melting point | 96-97°C |
| Boiling point | 389.6±25.0 °C(Predicted) |
| density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | Off-White Crystalline |
| BRN | 4457093 |
| InChI | InChI=1S/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3 |
| InChIKey | ZDZJOIIBECYKAJ-UHFFFAOYSA-N |
| SMILES | N1(C(C)C)C2=C(C=CC=C2)C(C2=CC=C(F)C=C2)=C1 |
| CAS DataBase Reference | 93957-49-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26-36-61 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
3-(4-Fluorophenyl)-1-isopropyl-1H-indole Usage And Synthesis
| Chemical Properties | Off-White Crystalline Solid |
| Uses | Fluvastatin (F601250) derivative. |
3-(4-Fluorophenyl)-1-isopropyl-1H-indole Preparation Products And Raw materials
| Preparation Products | 3-(4-FLUORO-PHENYL)-1-ISOPROPYL-1H-INDOLE-2-CARBALDEHYDE |
