Introduction：Basic information about 3,3-Diphenylpropiononitrile CAS 2286-54-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,3-Diphenylpropiononitrile Basic information
| Product Name: | 3,3-Diphenylpropiononitrile |
| Synonyms: | DIPHENYLPROPIONITRILE;2-CYANO-1,1-DIPHENYLETHANE;3,3-DIPHENYLPROPIONITRILE;3,3-diphenylpropiononitrile;3,3-DIPHENYLPROPIONTRILE;3,3-DIPHENYLPROPIONITRILE 97+%;3,3-diphenylpropion;3,3-Diphenylpropanenitrile |
| CAS: | 2286-54-6 |
| MF: | C15H13N |
| MW: | 207.27 |
| EINECS: | 218-926-0 |
| Product Categories: | |
| Mol File: | 2286-54-6.mol |
|
3,3-Diphenylpropiononitrile Chemical Properties
| Melting point | 86 °C |
| Boiling point | 174 °C / 3mmHg |
| density | 1.057±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C15H13N/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11H2 |
| InChIKey | INERKLNEVAZSCI-UHFFFAOYSA-N |
| SMILES | C(CC#N)(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 2286-54-6(CAS DataBase Reference) |
Safety Information
| RTECS | UG1700000 |
| HS Code | 2926.90.4801 |
3,3-Diphenylpropiononitrile Usage And Synthesis
3,3-Diphenylpropiononitrile Preparation Products And Raw materials
| Preparation Products | alpha-[1-(aminomethyl)propyl]benzhydryl alcohol-->prenylamine |
