Introduction：Basic information about 3,4,6-Tri-O-acetyl-D-galactal CAS 4098-06-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3,4,6-Tri-O-acetyl-D-galactal Basic information
| Product Name: | 3,4,6-Tri-O-acetyl-D-galactal |
| Synonyms: | (-)-TRI-O-ACETYL-D-GALACTAL;TRI-O-ACETYL-D-GALACTAL;D-GALACTAL TRIACETATE;3,4,6-TRI-O-ACETYL-D-GALACTAL;D- threeGalNAcene;(2R,3R,4R,5R,6R)-2-(acetoxymethyl)-5-azido-6-bromotetrahydro-2H-pyran-3,4-diyl diacetate;Tri-O-Acetyl-D-galacta;Tri-O-Acetyl-D-galactose |
| CAS: | 4098-06-0 |
| MF: | C12H16O7 |
| MW: | 272.25 |
| EINECS: | 223-859-5 |
| Product Categories: | Carbohydrates & Derivatives;13C & 2H Sugars;Biochemistry;Galactose;Glycals;O-Substituted Sugars;Sugars;Sugars, Carbohydrates & Glucosides;Glycon Biochem |
| Mol File: | 4098-06-0.mol |
|
3,4,6-Tri-O-acetyl-D-galactal Chemical Properties
| Melting point | 34-38 °C(lit.) |
| alpha | -20 º (c=1 CHCl3) |
| Boiling point | 138-140 °C |
| density | 1.23 |
| refractive index | 1.4645-1.4665 |
| Fp | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in chloroform at 10mg/ml |
| form | Oil or Solid |
| color | Pale Yellow |
| Water Solubility | Insoluble |
| InChI | InChI=1/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12-/s3 |
| InChIKey | LLPWGHLVUPBSLP-KJQXGZNINA-N |
| SMILES | [C@H]1(OC(=O)C)[C@@H](COC(=O)C)OC=C[C@H]1OC(=O)C |&1:0,5,14,r| |
| CAS DataBase Reference | 4098-06-0(CAS DataBase Reference) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 2940000080 |
3,4,6-Tri-O-acetyl-D-galactal Usage And Synthesis
| Chemical Properties | Pale Yellow Oil |
| Uses | 3,4,6-Tri-O-acetyl-D-galactal is important building block for both solution- and solid-phase synthesis of oligosaccharides. |
3,4,6-Tri-O-acetyl-D-galactal Preparation Products And Raw materials
| Raw materials | D-Galactitol, 1,5-anhydro-, 2,3,4,6-tetraacetate-->C00984-->D-Galactopyranose pentaacetate-->2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide-->2,3,4,6-TETRA-O-ACETYL-ALPHA-D-GALACTOPYRANOSYL CHLORIDE-->D-(+)-GALACTOSE-->Acetic anhydride |
| Preparation Products | D-Galactal-->6-O-(TRIISOPROPYLSILYL)-D-GALACTAL-->beta-D-Galactose pentaacetate-->TRI-O-BENZOYL-D-GALACTAL |
