Introduction：Basic information about 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine CAS 869718-81-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Basic information
- 2. 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Chemical Properties
- 3. Safety Information
- 4. 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Usage And Synthesis
- 5. 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Preparation Products And Raw materials
3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Basic information
| Product Name: | 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine |
| Synonyms: | 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine;MPEG8-NH2;m-dPEG(R)8-amine;2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine;m-PEG8-amine;3,6,9,12,15,18,21,24-;m-dPEG??-amine;m-dPEG8-Amine |
| CAS: | 869718-81-0 |
| MF: | C17H37NO8 |
| MW: | 383.48 |
| EINECS: | |
| Product Categories: | peg |
| Mol File: | 869718-81-0.mol |
|
3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Chemical Properties
| Boiling point | 448.0±40.0 °C(Predicted) |
| density | 1.054 |
| storage temp. | -20°C |
| solubility | Soluble in Water |
| form | solid or viscous liquid |
| pka | 8.74±0.10(Predicted) |
| color | Colorless to light yellow |
| InChI | InChI=1S/C17H37NO8/c1-19-4-5-21-8-9-23-12-13-25-16-17-26-15-14-24-11-10-22-7-6-20-3-2-18/h2-18H2,1H3 |
| InChIKey | YXWBFPPGROXJLL-UHFFFAOYSA-N |
| SMILES | C(N)COCCOCCOCCOCCOCCOCCOCCOC |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2922190090 |
| Storage Class | 11 - Combustible Solids |
3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Usage And Synthesis
| Description | m-PEG8-amine is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The hydrophilic PEG spacer increases solubility in aqueous media. |
| reaction suitability | reagent type: chemical modification reagent
reagent type: cross-linking reagent
reactivity: carboxyl reactive |
| Biological Activity | m-PEG8-Amine is a cleavable ADC linker for the synthesis of antibody-drug conjugates (ADCs). |
| target | 3,6,9,12,15,18,21,24-Octaoxapentacosan-1-amine Preparation Products And Raw materials| Raw materials | m-PEG9-Tos-->MPEG8-N3-->Octaethylene Glycol Monomethyl Ether |
|
