Introduction：Basic information about 3-BROMO-2-NITROTHIOPHENE CAS 24430-27-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-BROMO-2-NITROTHIOPHENE Basic information
| Product Name: | 3-BROMO-2-NITROTHIOPHENE |
| Synonyms: | 2-Nitro-3-bromothiophene;Thiophene,3-broMo-2-nitro- |
| CAS: | 24430-27-1 |
| MF: | C4H2BrNO2S |
| MW: | 208.03 |
| EINECS: | |
| Product Categories: | Heterocycle-oher series |
| Mol File: | 24430-27-1.mol |
|
3-BROMO-2-NITROTHIOPHENE Chemical Properties
| Melting point | 79-81 °C(Solv: hexane (110-54-3)) |
| Boiling point | 228.6±20.0 °C(Predicted) |
| density | 1.945±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| Appearance | Light yellow to light brown Solid |
| InChI | InChI=1S/C4H2BrNO2S/c5-3-1-2-9-4(3)6(7)8/h1-2H |
| InChIKey | UYIHKIRPUMUUJX-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)SC=CC=1Br |
Safety Information
3-BROMO-2-NITROTHIOPHENE Usage And Synthesis
3-BROMO-2-NITROTHIOPHENE Preparation Products And Raw materials
| Preparation Products | 2-[(2-nitrothiophen-3-yl)sulfanyl]acetic Acid |
