Introduction：Basic information about 3-Bromo-4-chloronitrobenzene CAS 16588-26-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Bromo-4-chloronitrobenzene Basic information
| Product Name: | 3-Bromo-4-chloronitrobenzene |
| Synonyms: | 1-BROMO-2-CHLORO-5-NITROBENZENE;3-BROMO-4-CHLORONITROBENZENE;Bromochloronitrobenzene;2-bromo-1-chloro-4-nitrobenzene;Benzene,2-broMo-1-chloro-4-nitro-;3-Bromo-4-chloronitrobenzene 95+%;3-BROMO-4-CHLORONITROBENZENE 97+%;3-Bromo-4-chloronitrobenzene > |
| CAS: | 16588-26-4 |
| MF: | C6H3BrClNO2 |
| MW: | 236.45 |
| EINECS: | 205-516-1 |
| Product Categories: | Miscellaneous |
| Mol File: | 16588-26-4.mol |
|
3-Bromo-4-chloronitrobenzene Chemical Properties
| Melting point | 58°C |
| Boiling point | 100 °C(Press: 0.1 Torr) |
| density | 1.827±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C6H3BrClNO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| InChIKey | CGTVUAQWGSZCFH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C([N+]([O-])=O)C=C1Br |
| CAS DataBase Reference | 16588-26-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| Hazard Note | Irritant |
| HS Code | 29049090 |
3-Bromo-4-chloronitrobenzene Usage And Synthesis
| Chemical Properties | Light yellow solid |
3-Bromo-4-chloronitrobenzene Preparation Products And Raw materials
| Raw materials | 2-Chloro-5-nitrobenzoic acid-->4-Chloronitrobenzene |
| Preparation Products | 2-BROMO-1-CHLORO-4-IODOBENZENE-->3-BROMO-4-CHLOROANILINE-->2-Chloro-5-nitro-biphenyl |
