Introduction：Basic information about 3-Bromo-6-chloro-2-methoxypyridine CAS 1211526-62-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Bromo-6-chloro-2-methoxypyridine Basic information
| Product Name: | 3-Bromo-6-chloro-2-methoxypyridine |
| Synonyms: | 3-Bromo-6-chloro-2-methoxypyridine;3-chloro-6-BroMo-2-Methoxypyridine;EOS-61232;Pyridine, 3-bromo-6-chloro-2-methoxy- |
| CAS: | 1211526-62-3 |
| MF: | C6H5BrClNO |
| MW: | 222.47 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1211526-62-3.mol |
|
3-Bromo-6-chloro-2-methoxypyridine Chemical Properties
| Boiling point | 227.3±35.0 °C(Predicted) |
| density | 1.650±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder |
| pka | -1.99±0.10(Predicted) |
| color | White fibrous |
| InChI | InChI=1S/C6H5BrClNO/c1-10-6-4(7)2-3-5(8)9-6/h2-3H,1H3 |
| InChIKey | NPCVTFQTUUYXQP-UHFFFAOYSA-N |
| SMILES | C1C=C(Br)C(OC)=NC=1Cl |
Safety Information
3-Bromo-6-chloro-2-methoxypyridine Usage And Synthesis
| Chemical Properties | White or Colorless to Light yellow powder to lump to clear liquid |
| Uses | 3-Bromo-6-chloro-2-methoxypyridine could be used to synthesis 3-(6-Chloro-2-methoxypyridin-3-yl)-3-methylpiperidin-2-one. |
3-Bromo-6-chloro-2-methoxypyridine Preparation Products And Raw materials
