3-Methyl-1-phenyl-2-phospholene 1-oxide CAS 707-61-9
Introduction：Basic information about 3-Methyl-1-phenyl-2-phospholene 1-oxide CAS 707-61-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
3-Methyl-1-phenyl-2-phospholene 1-oxide Basic information
| Product Name: | 3-Methyl-1-phenyl-2-phospholene 1-oxide |
| Synonyms: | 3-methyl-1-phenyl-2-phospholen1-oxide;3-METHYL-1-PHENYL-2-PHOSPHOLENE 1-OXIDE;3-METHYL-1-PHENYL-2-PHOSPHOLENE OXIDE;4-METHYL-1-PHENYL-2,3-DIHYDRO-1H-1LAMBDA5-PHOSPHOL-1-ONE;4-METHYL-1-PHENYL-2,3-DIHYDROPHOSPHOL-1-ONE;2,3-DIHYDRO-4-METHYL-1-PHENYL-1H-PHOSPHOLE 1-OXIDE;3-Methyl-1-Phenyl-2-Phosphelene 1-Oxide;3-METHYL-1-PHENYL-2-PHOSPHOLENE 1-OXIDE TECH., 85% |
| CAS: | 707-61-9 |
| MF: | C11H13OP |
| MW: | 192.19 |
| EINECS: | 211-901-5 |
| Product Categories: | Catalysis and Inorganic Chemistry;Phosphorus Compounds;Phosphorus Precursors;707-61-9 |
| Mol File: | 707-61-9.mol |
3-Methyl-1-phenyl-2-phospholene 1-oxide Chemical Properties
| Melting point | 58-62 °C |
| Boiling point | 150 °C/0.15 mmHg (lit.) |
| density | 1.11±0.1 g/cm3(Predicted) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in polar solvents. |
| form | Lumps |
| color | White to cream |
| Sensitive | Hygroscopic |
| BRN | 609223 |
| InChI | InChI=1S/C11H13OP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | YMKWWHFRGALXLE-UHFFFAOYSA-N |
| SMILES | P1(=O)(C2=CC=CC=C2)C=C(C)CC1 |
| CAS DataBase Reference | 707-61-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Phosphole, 2,3-dihydro-4-methyl-1-phenyl-, 1-oxide (707-61-9) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 26-28-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | SZ6105100 |
| TSCA | TSCA listed |
| HS Code | 2931499090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 |
| Chemical Properties | white to yellow adhering crystals |
| Uses | 3-Methyl-1-phenyl-2-phospholene 1-oxide is used as a catalyst for intramolecular aza-wittig cyclization reactions and polymerization reactions. It is a reactant used for the preparation of phospha sugars and their radical bromination derivatives as anticancer agents. |
| Application | Catalyst for: Intramolecular aza-Wittig cyclization reactions Polymerization reactions Reactant for preparation of: Phospha sugars and their radical bromination derivatives as anticancer agents |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling |
3-Methyl-1-phenyl-2-phospholene 1-oxide Preparation Products And Raw materials
| Raw materials | 1H-Phosphole,2,3-dihydro-1-methoxy-4-methyl-, 1-oxide-->1H-Phosphole, 1-chloro-2,3-dihydro-4-methyl-, 1-oxide-->3-METHYL-1-PHENYL-2-PHOSPHOLENE 1,1-DICHLORIDE, TECH., 85-->3-METHYL-1-PHENYL-3-PHOSPHOLENE 1-OXIDE-->Isoprene-->2-METHYL-1-BUTENE-->Dichlorophenylphosphine-->Phenylphosphonic dichloride |
