Introduction:Basic information about 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone CAS 2549-90-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Basic information
| Product Name: | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone |
| Synonyms: | 4-(2-Ethylhexyloxy)-2-hydroxybenzophenone;UF-5;UV Absorber 531L;Methanone, [4-[(2-ethylhexyl)oxy]-2-hydroxyphenyl]phenyl-;{4-[(2-ethylhexyl)oxy]-2-hydroxyphenyl}(phenyl)methanone;UV531L;4-(2-ethylhexoxy)-2-hydroxyphenyl]-phenylmethanone |
| CAS: | 2549-90-8 |
| MF: | C21H26O3 |
| MW: | 326.43 |
| EINECS: | 244-761-9 |
| Product Categories: | |
| Mol File: | 2549-90-8.mol |
|
4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Chemical Properties
| Boiling point | 424.46°C (rough estimate) |
| density | 1.0544 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| pka | 7.57±0.35(Predicted) |
| InChI | InChI=1S/C21H26O3/c1-3-5-9-16(4-2)15-24-18-12-13-19(20(22)14-18)21(23)17-10-7-6-8-11-17/h6-8,10-14,16,22H,3-5,9,15H2,1-2H3 |
| InChIKey | SLXIKWJMGICOAO-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OCC(CC)CCCC)C=C1O)(C1=CC=CC=C1)=O |
Safety Information
4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Usage And Synthesis
| Preparation | Preparation by reaction of 1-chloro-2-ethylhexane with resbenzophenone in the presence of barium hydroxide and arsenic tribromide in dimethyl sulfoxide at 80° for 3 h (93%). |
4-(2-Ethylhexyloxy)-2-hydroxybenzophenone Preparation Products And Raw materials