Introduction：Basic information about 4-(Trifluoromethyl)benzenesulfonamide CAS 830-43-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-(Trifluoromethyl)benzenesulfonamide Basic information
| Product Name: | 4-(Trifluoromethyl)benzenesulfonamide |
| Synonyms: | 4-(TrifluoroMethyl)benzenesulfonaide;Α,Α,Α-Trifluorotoluene-4-Sulfonamide;p-(trifluoromethyl)-benzenesulfonamid;3-(TRIFLUOROMETHYL)BENZENESULPHONAMIDE;4-(TRIFLUOROMETHYL)BENZENESULPHONAMIDE;4-(TRIFLUOROMETHYL)BENZENESULFONAMIDE;4-(TRIFLUOROMETHYL)SULPHONAMIDE;IFLAB-BB F1084-0062 |
| CAS: | 830-43-3 |
| MF: | C7H6F3NO2S |
| MW: | 225.19 |
| EINECS: | 212-596-1 |
| Product Categories: | Organic Building Blocks;Sulfonamides/Sulfinamides;Sulfur Compounds;API intermediates;Building Blocks;Chemical Synthesis;Organic Building Blocks;Sulfur Compounds |
| Mol File: | 830-43-3.mol |
|
4-(Trifluoromethyl)benzenesulfonamide Chemical Properties
| Melting point | 175-180 °C(lit.) |
| Boiling point | 304.8±52.0 °C(Predicted) |
| density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.68±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2695323 |
| InChI | InChI=1S/C7H6F3NO2S/c8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-4H,(H2,11,12,13) |
| InChIKey | TVHXQQJDMHKGGK-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 830-43-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37-26 |
| WGK Germany | 3 |
| RTECS | DB3200000 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
4-(Trifluoromethyl)benzenesulfonamide Usage And Synthesis
4-(Trifluoromethyl)benzenesulfonamide Preparation Products And Raw materials
| Preparation Products | N-(3-Methylphenyl)-4-(trifluoroMethyl)benzenesulfonaMide, 97% |
