Introduction：Basic information about 4-BENZYLANILINE CAS 1135-12-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-BENZYLANILINE Basic information
| Product Name: | 4-BENZYLANILINE |
| Synonyms: | 4-AMINODIPHENYLMETHANE;4-BENZYL-PHENYLAMINE;4-BENZYLANILINE;P-AMINODIPHENYL METHANE;TIMTEC-BB SBB010088;4-AMINODIPHENYLMETHANE 95+%;4-Benzylaniline 98%;4-benzylbenzenaMine |
| CAS: | 1135-12-2 |
| MF: | C13H13N |
| MW: | 183.25 |
| EINECS: | 672-757-0 |
| Product Categories: | Amines;C11 to C38;Nitrogen Compounds |
| Mol File: | 1135-12-2.mol |
|
4-BENZYLANILINE Chemical Properties
| Melting point | 35-38 °C(lit.) |
| Boiling point | 142-144°C 1mm |
| density | 1.0380 |
| refractive index | 1.6118 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 2.17(at 25℃) |
| form | powder to lump to clear liquid |
| color | White or colorless to Amber to Dark green |
| BRN | 2208463 |
| InChI | InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| InChIKey | WDTRNCFZFQIWLM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(CC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 1135-12-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |
| Storage Class | 11 - Combustible Solids |
4-BENZYLANILINE Usage And Synthesis
| Chemical Properties | Yellow Solid |
| Uses | 4-Benzylaniline (4-Aminodiphenylmethane) can be used to synthesize:
- 2-amino-6-benzylbenzothiazole (SKA-7)
- ethyl 2-((4-benzylphenylamino)methylen)-malonate
- bis(4-benzylphenyl)-urea
- 3:5-dibromo-4-aminodiphenylmethane via treatment with bromine solution
- 3:5-di-iodo-4-aminodiphenylmethane via iodination reaction by using a suitable iodinating reagent[sodium iodate + potassium iodide]
|
| General Description | 4-Benzylaniline (4-BA) undergoes hydrochlorination in the presence of HCl to yield 4-benzylaniline hydrochloride. Crystals of 4-BA exhibit monoclinic crystal system and space group P21/c. |
4-BENZYLANILINE Preparation Products And Raw materials
| Raw materials | 2-Methylbiphenyl-5-amine-->N-(p-Tolyl)hydroxylamine-->5-methyl-1,1'-biphenyl-2-amine-->Benzene |
| Preparation Products | N-(4-BENZYLOXY-PHENYL)-2-CHLORO-ACETAMIDE |
