Introduction：Basic information about 4-Benzyloxybromobenzene CAS 6793-92-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Benzyloxybromobenzene Basic information
| Product Name: | 4-Benzyloxybromobenzene |
| Synonyms: | 4-BENZYLOXYBROMOBENZENE, 98%4-BENZYLOXYBROMOBENZENE, 98%4-BENZYLOXYBROMOBENZENE, 98%4-BENZYLOXYBROMOBENZENE, 98%;1-Bromo-4-benzyloxybenzen;1-(Benzyloxy)-4-bromobenzene 98%;BENZYLOXY-4-BROMO BENZENE;1-Bromo-4-benzyloxybzenzene;Benzyloxybromobenzene;AURORA KA-4380;BENZYL 4-BROMOPHENYL ETHER |
| CAS: | 6793-92-6 |
| MF: | C13H11BrO |
| MW: | 263.13 |
| EINECS: | 614-179-3 |
| Product Categories: | Building Blocks;C13 to C14;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Aromatics Compounds;Building Blocks for Liquid Crystals;Chalcones, etc. (Building Blocks for Liquid Crystals);Functional Materials;Aromatics;Ethers;Organic Building Blocks;Oxygen Compounds;alkyl bromide;Aromatic Halides (substituted) |
| Mol File: | 6793-92-6.mol |
|
4-Benzyloxybromobenzene Chemical Properties
| Melting point | 60-63 °C (lit.) |
| Boiling point | 166-167 °C/4 mmHg (lit.) |
| density | 1.3883 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| Fp | 166-167°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly, Heated) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1371040 |
| InChI | InChI=1S/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | OUQSGILAXUXMGI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OCC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 6793-92-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Benzyloxybromobenzene(6793-92-6) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
4-Benzyloxybromobenzene Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | 1-Benzyloxy-4-Bromobenzene is used in preparation of arylalkenylpropargylamine derivatives as MAO-B inhibitors exhibiting neuroprotective action for treatment of neurodegenerative diseases. |
| Synthesis | The synthesis of 4-benzyloxybromobenzene was as follows: p-bromophenol, benzyl chloride, anhydrous potassium carbonate and potassium iodide were placed in a 250 ml three-necked flask and 170 ml of anhydrous ethanol was added. The reaction was heated and refluxed at 80?? for 6h with stirring, and was detected by TLC .TLC detection, the raw materials are basically reacted completely. The reaction was stopped and the reaction solution was poured into 1000ml distilled water.distilled water, stirred thoroughly to remove the residual inorganic salts. Filtering, the class white solid, anhydrous ethanol recrystallization, 50g off-white powder, yield 88.5%. |
4-Benzyloxybromobenzene Preparation Products And Raw materials
| Raw materials | Benzene, [[(trifluoromethyl)sulfonyl]methyl]--->4-Bromophenyl triflate-->4-BENZYLOXYBENZYL ALCOHOL-->BENZYLBORONIC ACID PINACOL ESTER-->(4-BROMOPHENOXY)TRIMETHYLSILANE-->4-BROMOPHENOL ACETATE-->(4-BROMOPHENOXY)-TERT-BUTYLDIMETHYLSILANE-->Benzyl chloride-->4-Bromophenol |
| Preparation Products | 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine-->Bromobenzene-->BENZYL PHENYL ETHER-->4-BENZYLOXYANILINE-->2-(4-(benzyloxy)phenyl)propan-2-ol |
