Introduction:Basic information about 4-Bromo-2-(trifluoromethoxy)aniline CAS 175278-09-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromo-2-(trifluoromethoxy)aniline Basic information
| Product Name: | 4-Bromo-2-(trifluoromethoxy)aniline |
| Synonyms: | BUTTPARK 50\01-74;TIMTEC-BB SBB005835;2-AMINO-5-BROMO TRIFLUOROMETHOXY BENZENE;4-BROMO-2-(TRIFLUOROMETHOXY)ANILINE;4-bromo-2-(trifluoromrthoxy)aniline;4-Bromo-2-(trifluoromethoxy)aniline 98%;4-Bromo-2-(trifluoromethoxy)aniline98%;4-Bromo-2-trifluoromethoxyaniline,97% |
| CAS: | 175278-09-8 |
| MF: | C7H5BrF3NO |
| MW: | 256.02 |
| EINECS: | |
| Product Categories: | Fluorine series;Nitrogen Compounds;Amines;Building Blocks;Chemical Synthesis;Organic Building Blocks;Trifluoroanisole series;Anilines, Aromatic Amines and Nitro Compounds;C7;Nitrogen Compounds |
| Mol File: | 175278-09-8.mol |
|
4-Bromo-2-(trifluoromethoxy)aniline Chemical Properties
| Boiling point | 98-100 °C/15 mmHg (lit.) |
| density | 1.691 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.5130(lit.) |
| Fp | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 1.75±0.10(Predicted) |
| Appearance | Colorless to off-white <26°C Solid,>27°C Liquid |
| InChI | InChI=1S/C7H5BrF3NO/c8-4-1-2-5(12)6(3-4)13-7(9,10)11/h1-3H,12H2 |
| InChIKey | QVILSWLYJYMGRN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1OC(F)(F)F |
| CAS DataBase Reference | 175278-09-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-43-52/53-36/37/38 |
| Safety Statements | 36/37-45-37/39-26 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29222990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
4-Bromo-2-(trifluoromethoxy)aniline Usage And Synthesis
| Chemical Properties | clear pale yellow to orange-yellow liquid |
| Uses | 4-Bromo-2-(trifluoromethoxy)aniline is a versatile building block that can be used to create a range of compounds, such as methyl 4- amino-3-(trifluoromethoxy)benzoate, 1-Bromo-3-(trifluoromethoxy)benzene, etc. To a solution of 4-bromo-2-(trifluoromethoxy)aniline (10 g, 50.21 mmol) in methanol (150 mL) in a pressure tank reactor was added TEA (11.84 g, 117.01 mmol), Pd(dppf)Ci2 CH2Q2 (2.4 g, 2.94 mmol). Then the reactor was charged with CO (g) (20 atm). The resulting reaction was stirred for 1.5 days at 100°C. Then it was diluted with water (200 mL), extracted with ethyl acetate (3 x 100 mL) and the organic layers combined and dried in an oven under reduced pressure. The resulting mixture was concentrated in a vacuo. The residue was purified by silica gel column chromatography with ethyl acetate/petroleum ether (1:50) to afford methyl 4- amino-3-(trifluoromethoxy)benzoate as yellow solid (5 g, 54 %). |
4-Bromo-2-(trifluoromethoxy)aniline Preparation Products And Raw materials
| Preparation Products | 3-(Trifluoromethoxy)bromobenzene |