Introduction：Basic information about 4-Bromo-2,6-difluoroanisole CAS 104197-14-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromo-2,6-difluoroanisole Basic information
| Product Name: | 4-Bromo-2,6-difluoroanisole |
| Synonyms: | 4-BROMO-2,6-DIFLUOROANISOLE;4-Bromo-2,6-difluoroanisole, 97+%;4-Bromo-2,6-difluoroanisole 98%;4-Bromo-2,6-difluoroanisole98%;4-bromo-2,6-difluorophenyl methyl ether;5-bromo-1,3-difluoro-2-methoxybenzene;4-Bromo-2,6-difluorophenyl methyl ether, 5-Bromo-1,3-difluoro-2-methoxybenzene;4-Bromo-2,6-difluoroanisole > |
| CAS: | 104197-14-0 |
| MF: | C7H5BrF2O |
| MW: | 223.01 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 104197-14-0.mol |
|
4-Bromo-2,6-difluoroanisole Chemical Properties
| Boiling point | 80-100°C 15mm |
| density | 1.65 |
| Fp | 80-100°C/15mm |
| refractive index | 1.5100 |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Light yellow to Brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H5BrF2O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 |
| InChIKey | CDOQKISJPOWBKC-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC(F)=C1OC |
| CAS DataBase Reference | 104197-14-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2909303890 |
4-Bromo-2,6-difluoroanisole Usage And Synthesis
| Chemical Properties | light yellow liquid |
| Uses | t is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. |
4-Bromo-2,6-difluoroanisole Preparation Products And Raw materials
| Preparation Products | 1-(3,5-difluoro-4-methoxyphenyl)-2,2,2-trifluoroethanone |
