Introduction：Basic information about 4-Bromo-2-fluoro-1-iodobenzene CAS 105931-73-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromo-2-fluoro-1-iodobenzene Basic information
| Product Name: | 4-Bromo-2-fluoro-1-iodobenzene |
| Synonyms: | 4-BROMO-2-FLUORO-1-IODOBENZENE;4-BROMO-2-FLUOROIODOBENZENE;2-FLUORO-4-BROMOIODOBENZENE;1-BROMO-3-FLUORO-4-IODOBENZENE;3-Fluoro-4-iodo-1-bromobenzene;3-Fluoro-4-iodobromobenzene, 95%;1-Bromo-3-fluoro-4-iodobenzene [4-Bromo-3-fluoroiodobenzene];1-Bromo-3-fluoro-4-iodobenzene, 99+% |
| CAS: | 105931-73-5 |
| MF: | C6H3BrFI |
| MW: | 300.89 |
| EINECS: | 629-334-0 |
| Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Bromine Compounds;Fluorine Compounds;Iodine Compounds;Aryl;Halogenated Hydrocarbons;Aromatic Halides (substituted);Others;bc0001;C6 |
| Mol File: | 105931-73-5.mol |
|
4-Bromo-2-fluoro-1-iodobenzene Chemical Properties
| Melting point | 48-51 °C (lit.) |
| Boiling point | 243.9±20.0 °C(Predicted) |
| density | 2.2691 (estimate) |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder, Crystals, and/or Chunks |
| color | Off-white to beige |
| Sensitive | Light Sensitive |
| BRN | 4740250 |
| InChI | InChI=1S/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| InChIKey | XRMZKCQCINEBEI-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 105931-73-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
4-Bromo-2-fluoro-1-iodobenzene Usage And Synthesis
| Chemical Properties | Clear colourless to light yellow liquid |
| Uses | 3-Fluoro-4-iodobromobenzene may be used in chemical synthesis. |
4-Bromo-2-fluoro-1-iodobenzene Preparation Products And Raw materials
| Preparation Products | 4-Bromo-2-fluoro-1-(methylsulfonyl)benzene-->Benzo[b]naphtho[2,3-d]furan, 3-bromo--->3-Bromodibenzo[b,d]furan-->1-Bromo-3-fluoro-4-iodo-2-methyl-benzene-->4-BROMO-2-FLUORO-1-VINYLBENZENE-->4-Bromo-2,3',4',5'-tetrafluorobiphenyl |
