Introduction：Basic information about 4-Iodobenzoyl chloride CAS 1711-02-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Iodobenzoyl chloride Basic information
| Product Name: | 4-Iodobenzoyl chloride |
| Synonyms: | 4-iodo-benzoylchlorid;Benzoyl chloride, p-iodo-;Benzoylchloride,4-iodo-;P-IODOBENZOYL CHLORIDE;4-IODOBENZOYL CHLORIDE;4-Iodobenzoic acid chloride;4-Iodobenzoyl chloride,98%;4-Iodobenzoylchloride97% |
| CAS: | 1711-02-0 |
| MF: | C7H4ClIO |
| MW: | 266.46 |
| EINECS: | 216-974-7 |
| Product Categories: | Aromatic Halides (substituted);Acid Halides;Carbonyl Compounds;Organic Building Blocks |
| Mol File: | 1711-02-0.mol |
|
4-Iodobenzoyl chloride Chemical Properties
| Melting point | 63-65 °C (lit.) |
| Boiling point | 120-121 °C/1 mmHg (lit.) |
| density | 1.9367 (estimate) |
| Fp | >110°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in toluene and benzene. |
| form | Crystalline Powder and Chunks or Crystalline Mass |
| color | Light yellow to beige |
| Sensitive | Moisture Sensitive |
| BRN | 774718 |
| InChI | InChI=1S/C7H4ClIO/c8-7(10)5-1-3-6(9)4-2-5/h1-4H |
| InChIKey | NJAKCIUOTIPYED-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(I)C=C1 |
| CAS DataBase Reference | 1711-02-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 4-iodo-(1711-02-0) |
| EPA Substance Registry System | Benzoyl chloride, 4-iodo- (1711-02-0) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 28A-26-45-36/37/39 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
4-Iodobenzoyl chloride Usage And Synthesis
| Chemical Properties | light yellow to beige crystalline powder and |
| Uses | 4-Iodobenzoyl chloride is employed in the preparation of pyrroles by reaction with imines and acetylenes mediated by isocyanides using palladium catalysis. It is also used in the preparation of N-(1-benzylpyrrolidin-3-yl)arylbenzamides, potential human dopamine D4 antagonists. Further, it is used to prepare [2]rotaxane monomer and poly[2] rotaxane. In addition to this, it is important in the modification of poly(allylamine) in order to make the polymer X-ray visible. |
4-Iodobenzoyl chloride Preparation Products And Raw materials
| Raw materials | 1-Naphthoyl chloride-->4-Iodobenzoic acid-->Iodobenzene-->1-Iodonaphthalene-->Terephthaloyl chloride-->Oxalyl chloride |
| Preparation Products | 2-Thiophenecarbonyl chloride-->4-(METHYLTHIO)BENZOYL CHLORIDE 95-->cis-3-Hexenyl benzoate-->o-Toluoyl chloride-->p-Toluoyl chloride-->1-Iodo-4-nitrobenzene-->Piperonyloyl chloride-->Benzoyl chloride-->3-Thiophenecarbonyl chloride-->N-(Cyclopropylmethyl)-4-iodobenzamide |
