Introduction：Basic information about 4-Methoxy-2-nitrophenol CAS 1568-70-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Methoxy-2-nitrophenol Basic information
| Product Name: | 4-Methoxy-2-nitrophenol |
| Synonyms: | 4-METHOXY-2-NITROPHENOL, TECH.;4-METHOXY-2-NITROPHENOL;4-HYDROXY-3-NITROANISOLE;3-NITROHYDROQUINONE MONO-METHYL ETHER;TIMTEC-BB SBB008447;4-Methoxy-2-nitrophenol,98%;4-Methoxy-2-nitrophenol,99+%;4-Methoxy-2-nitrophenol≥ 98% (GC) |
| CAS: | 1568-70-3 |
| MF: | C7H7NO4 |
| MW: | 169.13 |
| EINECS: | |
| Product Categories: | Isoquinolines ,Quinolines ,Quinaldines;Phenoles and thiophenoles;Organic Building Blocks;Oxygen Compounds;Phenols;Aromatic Phenols |
| Mol File: | 1568-70-3.mol |
|
4-Methoxy-2-nitrophenol Chemical Properties
| Melting point | 78-80 °C (lit.) |
| Boiling point | 298.4°C (rough estimate) |
| density | 1.3375 (estimate) |
| refractive index | 1.5830 (rough estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol almost transparency. |
| pka | 7.33±0.14(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | 1S/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3 |
| InChIKey | YBUGOACXDPDUIR-UHFFFAOYSA-N |
| SMILES | COc1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 1568-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-methoxy-2-nitro-(1568-70-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
4-Methoxy-2-nitrophenol Usage And Synthesis
| Chemical Properties | orange-brown powder and chunks |
| Uses | 4-Methoxy-2-nitrophenol can treat obesity, prevent weight gain, promote weight loss, promote slimming, or treat or prevent the development of diabetes. |
4-Methoxy-2-nitrophenol Preparation Products And Raw materials
| Preparation Products | 3-Bromo-2,5-dimethoxyaniline-->BENZOXAZOLE, 2-CHLORO-5-METHOXY--->2-Amino-6-bromo-4-methoxyphenol-->3,4-dihydro-2H-1,4-benzoxazin-6-ol |
