Introduction：Basic information about 4-Methoxyisophthalic acid CAS 2206-43-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Methoxyisophthalic acid Basic information
| Product Name: | 4-Methoxyisophthalic acid |
| Synonyms: | 4-Methoxy Sophthalic Acid;p-MethoxySophthalicAcid;4-METHOXYISOPHTHALIC ACID 98%;4-Methoxybenzene-1,3-dicarboxylic acid;4-Methoxyisophthalic acid;p-Methoxyisophthalic Acid;Room 4-methoxy-acid;5-METHOXY-1,3 DICARBOXYLIC ACID |
| CAS: | 2206-43-1 |
| MF: | C9H8O5 |
| MW: | 196.16 |
| EINECS: | 218-618-6 |
| Product Categories: | Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;C9;Carbonyl Compounds;Carboxylic Acids;Organic acids;API intermediates;Phthalic Acids, Esters and Derivatives |
| Mol File: | 2206-43-1.mol |
|
4-Methoxyisophthalic acid Chemical Properties
| Melting point | 275-280 °C(lit.) |
| Boiling point | 271 °C |
| density | 1.416±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.72±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H8O5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | JIICYHFLIOGGHE-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(OC)C(C(O)=O)=C1 |
| CAS DataBase Reference | 2206-43-1(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |
4-Methoxyisophthalic acid Usage And Synthesis
| Chemical Properties | White tooff-white powder |
| Uses | Picotamide impurity A EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| General Description | 4-Methoxyisophthalic acid can be prepared by employing the following as a starting material:
- its dimethyl analog
- p-cresol
- 4-methoxy-m-xylene
- 3-methyl-4-methoxybenzyl chloride
|
4-Methoxyisophthalic acid Preparation Products And Raw materials
| Raw materials | Dimethyl 4-methoxyisophthalate-->1-(2-METHOXY-5-METHYLPHENYL)ETHANONE-->2,4-DIMETHYLANISOLE |
