Introduction：Basic information about 4-tert-Butyl-2-nitrophenol CAS 3279-07-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-tert-Butyl-2-nitrophenol Basic information
| Product Name: | 4-tert-Butyl-2-nitrophenol |
| Synonyms: | Phenol, 4-(1,1-dimethylethyl)-2-nitro;2-NITRO-4-TERT-BUTYLPHENOL;4-T-BUTYL-2-NITROPHENOL;4-TERT-BUTYL-2-NITROPHENOL;2-Nitryl-4-tert-butylphenol;O-NITRO-P-(TERT)BUTYL PHENOL;4-TERT-BUTYL-2-NITROPHENOL 98+%;4-tert-Butyl-2-nitrophenol > |
| CAS: | 3279-07-0 |
| MF: | C10H13NO3 |
| MW: | 195.22 |
| EINECS: | 221-914-8 |
| Product Categories: | Building Blocks;C9 to C20+;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Organic Building Blocks;Oxygen Compounds;Phenols;Industrial/Fine Chemicals;Aromatic Phenols |
| Mol File: | 3279-07-0.mol |
|
4-tert-Butyl-2-nitrophenol Chemical Properties
| Melting point | 27-29 °C(lit.) |
| Boiling point | 97 °C1 mm Hg(lit.) |
| density | 1.12 g/mL at 25 °C(lit.) |
| refractive index | 1.5500-1.5530 |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| pka | 7.37±0.14(Predicted) |
| form | Yellow to Dark Yellow Oil to Semi-Solid |
| color | Orange to Brown |
| Stability: | Hygroscopic |
| InChI | 1S/C10H13NO3/c1-10(2,3)7-4-5-9(12)8(6-7)11(13)14/h4-6,12H,1-3H3 |
| InChIKey | IHGNADPMUSNTJW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 3279-07-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Tert-butyl-2-nitrophenol(3279-07-0) |
| EPA Substance Registry System | Phenol, 4-(1,1-dimethylethyl)-2-nitro- (3279-07-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
4-tert-Butyl-2-nitrophenol Usage And Synthesis
| Chemical Properties | Yellow low melting solid |
| Uses | 4-tert-Butyl-2-nitrophenol may be used for the preparation of (2-hydroxy-3-nitro-5-tert-butylbenzyl)trimethylammonium iodide. |
4-tert-Butyl-2-nitrophenol Preparation Products And Raw materials
| Preparation Products | 2-Amino-4-tert-butylphenol-->4-tert-Butyl-2-nitrophenyl propyl ether |
