Introduction:Basic information about 4-tert-Butylphenylhydrazine hydrochloride CAS 36600-66-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-tert-Butylphenylhydrazine hydrochloride Basic information
| Product Name: | 4-tert-Butylphenylhydrazine hydrochloride |
| Synonyms: | 1-[4-(TERT-BUTYL)PHENYL]HYDRAZINE HYDROCHLORIDE;4-TERT-BUTYLPHENYLHYDRAZINE HCL;4-TERT-BUTYLPHENYLHYDRAZINE HYDROCHLORIDE;4-TERT-BUTYLPHENYLHYDRAZINE MONOHYDROCHLORIDE;4-tert-Butylphenylhydrazinehydrochloride,97%;(4-(tert-Butyl)phenyl)hydrazine hydrochloride(1:x);4-tert-Butylphenylhydrazine hydrochloride ISO 9001:2015 REACH;36600-66-5 (Hydrazine,[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:?) ) |
| CAS: | 36600-66-5 |
| MF: | C10H17ClN2 |
| MW: | 200.71 |
| EINECS: | 1312995-182-4 |
| Product Categories: | Hydrazines;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 36600-66-5.mol |
|
4-tert-Butylphenylhydrazine hydrochloride Chemical Properties
| Melting point | 212-216 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| InChI | InChI=1S/C10H16N2.ClH/c1-10(2,3)8-4-6-9(12-11)7-5-8;/h4-7,12H,11H2,1-3H3;1H |
| InChIKey | VTESCYNPUGSWKG-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(C(C)(C)C)C=C1)N.[H]Cl |
| CAS DataBase Reference | 36600-66-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29280000 |
4-tert-Butylphenylhydrazine hydrochloride Usage And Synthesis
4-tert-Butylphenylhydrazine hydrochloride Preparation Products And Raw materials