Introduction：Basic information about 5-Chloroisatin CAS 17630-76-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-Chloroisatin Basic information
| Product Name: | 5-Chloroisatin |
| Synonyms: | 5-Chloroisatin,95%;5-Chloroindolin-2,3-dione;5-Chloroisatin ,98%;Indole-2,3-dione, 5-chloro- (7CI,8CI);Isatin, 5-chloro- (6CI);NSC 135811;5-Chloroindolin-2,3-dione, 5-Chloro-1H-indole-2,3-dione;TIMTEC-BB SBB003741 |
| CAS: | 17630-76-1 |
| MF: | C8H4ClNO2 |
| MW: | 181.58 |
| EINECS: | 241-614-0 |
| Product Categories: | Indane/Indanone and Derivatives |
| Mol File: | 17630-76-1.mol |
|
5-Chloroisatin Chemical Properties
| Melting point | 254-258 °C (lit.) |
| density | 1.3743 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 8.65±0.20(Predicted) |
| Appearance | Yellow to orange Solid |
| Water Solubility | insoluble |
| BRN | 383759 |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 17630-76-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
5-Chloroisatin Usage And Synthesis
| Chemical Properties | pale yellow to reddish or yellow-brownish powder |
| Uses | 5-Chloroisatin is a reagent used in the synthesis of Schiff bases through the reaction with 2-methyl-4-nitroaniline or 4-amino-4,5-dihydro-1H-1,2,3-triazole-5-one. |
| Definition | ChEBI: 5-Chloro-1H-indole-2,3-dione is a member of indoles. It has a role as an anticoronaviral agent. |
| General Description | 5-Chloroisatin reacts with substituted 4-amino-4,5-dihydro-1H-1,2,4-triazole-5-ones to yield Schiff bases. |
5-Chloroisatin Preparation Products And Raw materials
| Raw materials | 5-Chloroindole-->Chloral hydrate-->carbon monoxide-->Isatin-->4-Chloroaniline |
| Preparation Products | 5-CHLORO INDAZOLE-3-CARBOXALDEHYDE-->(5-Chloro-1H-indazol-3-yl)-methanol ,97%-->5-Chlorooxindole-->5-Chloro-1H-indazole-3-carboxylic acid-->2-Amino-5-chlorobenzoic acid-->6-CHLORO-2-(4-METHOXYPHENYL)QUINOLINE-4-CARBOXYLIC ACID-->Benzenamine,2-(1H-benzimidazol-2-yl)-4-chloro--->5-CHLORO-1-(2,6-DICHLOROBENZYL)-1H-INDOLE-2,3-DIONE-->6-CHLORO-2-(4-ETHYLPHENYL)QUINOLINE-4-CARBOXYLICACID-->5-CHLORO-1-METHYLINDOLIN-2-ONE |
