Introduction：Basic information about 5-Nitroso-2,4,6-triaminopyrimidine CAS 1006-23-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-Nitroso-2,4,6-triaminopyrimidine Basic information
| Product Name: | 5-Nitroso-2,4,6-triaminopyrimidine |
| Synonyms: | IFLAB-BB F1918-0051;5-NITROSO-2,4,6-TRIAMINOPYRIMIDINE;5-NITROSO-PYRIMIDINE-2,4,6-TRIAMINE;2,4,6-TRIAMINO-5-NITROSOPYRIMIDINE;Triamterene EP Impurity A;6-pyrimidinetriamine,5-nitroso-4;5-nitropyrimidine-2,4,6-triamine;2,4,6-Triamino-5-nitroisopyrimidine |
| CAS: | 1006-23-1 |
| MF: | C4H6N6O |
| MW: | 154.13 |
| EINECS: | 213-742-7 |
| Product Categories: | Nucleic acids;Bases & Related Reagents;Nucleotides;Nucleotides and Nucleosides;Pyrimidines;Pyridines, Pyrimidines, Purines and Pteredines;Amines |
| Mol File: | 1006-23-1.mol |
|
5-Nitroso-2,4,6-triaminopyrimidine Chemical Properties
| Melting point | 300 °C |
| Boiling point | 277.47°C (rough estimate) |
| density | 1.4788 (rough estimate) |
| refractive index | 1.7290 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMF (Slightly, Heated), DMSO (Slightly, Heated) |
| pka | 4.07±0.10(Predicted) |
| color | Light Pink to Pink |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9) |
| InChIKey | XLQQJSWJHHKLOK-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(N)=C(N=O)C(N)=N1 |
| CAS DataBase Reference | 1006-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Pyrimidinetriamine, 5-nitroso- (1006-23-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
5-Nitroso-2,4,6-triaminopyrimidine Usage And Synthesis
| Chemical Properties | Orange Solid |
| Uses | 5-Nitroso-2,4,6-triaminopyrimidine (cas# 1006-23-1) is a compound useful in organic synthesis. |
| Synthesis Reference(s) | Journal of the American Chemical Society, 79, p. 1518, 1957 DOI: 10.1021/ja01563a078 |
| Flammability and Explosibility | Not classified |
| Synthesis | 5-Nitroso-2,4,6-triaminopyrimidine can be prepared by reacting 6-aminopyrimidine-2,4-diamine with NaNO2. |
5-Nitroso-2,4,6-triaminopyrimidine Preparation Products And Raw materials
| Raw materials | 2,4,6-Triaminopyrimidine |
| Preparation Products | (2,4-DIAMINOPTERIDIN-6-YL)METHANOL HYDROCHLORIDE HYDRATE-->Triamterene-->2,4,5,6-TETRAAMINOPYRIMIDINE |
