Introduction:Basic information about 6-tert-butyl-4-hydroxy-2H-pyran-2-one CAS 857248-84-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-tert-butyl-4-hydroxy-2H-pyran-2-one Basic information
| Product Name: | 6-tert-butyl-4-hydroxy-2H-pyran-2-one |
| Synonyms: | 6-tert-butyl-4-hydroxy-2H-pyran-2-one;2H-Pyran-2-one, 6-(1,1-dimethylethyl)-4-hydroxy-;6-(1,1-Dimethylethyl)-4-hydroxy-2H-pyran-2-one;6-tert-butyl-4-hydroxy-pyran-2-one - [B87578] |
| CAS: | 857248-84-1 |
| MF: | C9H12O3 |
| MW: | 168.19 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 857248-84-1.mol |
|
6-tert-butyl-4-hydroxy-2H-pyran-2-one Chemical Properties
| Melting point | 131-133 °C |
| Boiling point | 263.0±40.0 °C(Predicted) |
| density | 1.203±0.06 g/cm3(Predicted) |
| storage temp. | Store at 0-8 °C |
| pka | 5.20±0.30(Predicted) |
| Appearance | white solid |
| InChI | InChI=1S/C9H12O3/c1-9(2,3)7-4-6(10)5-8(11)12-7/h4-5,10H,1-3H3 |
| InChIKey | VJYOVPGKVUBPFS-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(C(C)(C)C)=CC(O)=C1 |
Safety Information
6-tert-butyl-4-hydroxy-2H-pyran-2-one Usage And Synthesis
| Uses | 6-tert-butyl-4-hydroxy-2H-pyran-2-one is an optoelectronic material intermediate capable of synthesizing OLED materials. |
| Preparation | 6-tert-butyl-4-hydroxy-2H-pyran-2-one were prepared under mildreaction conditions by the reaction of 2,2,6-trimethyl-1,3-dioxin-4-one with 1-acylbenzotriazoles 9 in the presenceof LDA followed by thermal cyclization.
|
6-tert-butyl-4-hydroxy-2H-pyran-2-one Preparation Products And Raw materials