Introduction：Basic information about 8-Hydroxyquinoline-5-sulfonic acid CAS 84-88-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
8-Hydroxyquinoline-5-sulfonic acid Basic information
| Product Name: | 8-Hydroxyquinoline-5-sulfonic acid |
| Synonyms: | 5-Sulfo-8-hydroxyquinoline;5-Sulfo-8-quinolinol;5-Sulfooxine;8-hydroxy-5-quinolinesulfonicaci;8-Hydroxy-5-sulfoquinoline;8-Hydroxyquinoline-5-sulfonate;8-Hydroxyquinoline-5-sulfonic;8-Hydroxyquinoline-5-sulphonic acid |
| CAS: | 84-88-8 |
| MF: | C9H7NO4S |
| MW: | 225.22 |
| EINECS: | 201-570-5 |
| Product Categories: | Building Blocks;C8 to C10;Building Blocks;Heterocyclic Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;Quinoline series;Organic acids;Hydroxyquinolines;Quinolines |
| Mol File: | 84-88-8.mol |
|
8-Hydroxyquinoline-5-sulfonic acid Chemical Properties
| Melting point | 311-313°C |
| density | 1.4899 (rough estimate) |
| refractive index | 1.5364 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| pka | pK1:4.092(＋1);pK2:8.776(0) (25°C) |
| form | crystalline |
| color | yellow to green |
| Merck | 4844 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H7NO4S/c11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7/h1-5,11H,(H,12,13,14) |
| InChIKey | LGDFHDKSYGVKDC-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(S(O)(=O)=O)C=CC=2O)C=CC=1 |
| CAS DataBase Reference | 84-88-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Quinolinesulfonic acid, 8-hydroxy-(84-88-8) |
| EPA Substance Registry System | 5-Quinolinesulfonic acid, 8-hydroxy- (84-88-8) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | VC2570000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29334990 |
8-Hydroxyquinoline-5-sulfonic acid Usage And Synthesis
| Chemical Properties | Yellow fine crystalline powder |
| Uses | 8-Hydroxy-5-quinolinesulfonic acid is used in the synthesis of fat mass and obesity associated proteins. Also used in the synthesis of anti-schitosomal compounds. |
| Purification Methods | Crystallise the acid from water (as the 1.5 hydrate, m 316-317o) or dilute HCl (ca 2% by weight). [Beilstein 22 I 620, 22 II 313, 22 III/IV 3493.] |
8-Hydroxyquinoline-5-sulfonic acid Preparation Products And Raw materials
| Raw materials | FUMING SULFURIC ACID-->8-Hydroxyquinoline |
