Introduction:Basic information about AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- CAS 183905-31-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- Basic information
| Product Name: | AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- |
| Synonyms: | [(2S)-1-acetamido-3-chloropropan-2-yl] acetate;Linezolid Impurity 82;(S)-1-[(Acetylamino)methyl]-2-chloroethyl acetate;(S)-Acetic acid 2-acetylamino-1-chloromethylethyl ester;(S)-N-[2-(Acetyloxy)-3-chloropropyl]acetamide;N-[(2S)-2-(Acetyloxy)-3-chloropropyl]acetamide;N-[(2S)-2-Acetoxy-3-chloropropyl]acetamide;(S)-1-AcetaMido-3-chloropropan-2-yl acetate |
| CAS: | 183905-31-9 |
| MF: | C7H12ClNO3 |
| MW: | 193.63 |
| EINECS: | 1806241-263-5 |
| Product Categories: | |
| Mol File: | 183905-31-9.mol |
|
AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- Chemical Properties
| Boiling point | 370.2±32.0 °C(Predicted) |
| density | 1.171 |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 15.42±0.46(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C7H12ClNO3/c1-5(10)9-4-7(3-8)12-6(2)11/h7H,3-4H2,1-2H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | GOJJPJCUSDMTAT-SSDOTTSWSA-N |
| SMILES | C(NC[C@H](OC(C)=O)CCl)(=O)C |
Safety Information
AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- Usage And Synthesis
| Uses | (S)-N-(2-acetoxy-3-chloropropane)acetamide has applications in pharmaceutical and biochemical industries and is an intermediate in the synthesis of linadiazonamide. |
| Chemical Properties | White crystals |
AcetaMide, N-[(2S)-2-(acetyloxy)-3-chloropropyl]- Preparation Products And Raw materials
| Preparation Products | (S)-N-[3-(3-FLUORO-4-IODO-PHENYL)-2-OXO-OXAZOLIDIN-5-YLMETHYL]-ACETAMIDE |