Acetamiprid CAS 160430-64-8
Introduction：Basic information about Acetamiprid CAS 160430-64-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Acetamiprid Basic information
| Product Name: | Acetamiprid |
| Synonyms: | N-((6-CHLOROPYRIDIN-3-YL)METHYL)-N'-CYANO-N-METHYLACETAMIDINE;MORTAL;MOSPILAN;MOSPILDATE;N-(6-Chloro-3-pyridylmethyl)-N-cyano-N-methylacetamidine;Assail;(E)-N-((6-Chloro-3-pyridinyl)methyl)-N'-cyano-N-methyl-ethanimidamide;(E)-N-(6-CHLORO-3-PYRIDYLMETHYL)-N'-CYANO-N-METHYLACETAMIDINE |
| CAS: | 160430-64-8 |
| MF: | C10H11ClN4 |
| MW: | 222.67 |
| EINECS: | |
| Product Categories: | Pesticide;INSECTICIDE;Biochemistry agonist |
| Mol File: | 160430-64-8.mol |
Acetamiprid Chemical Properties
| Melting point | 100-102°C |
| storage temp. | 2-8°C |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3/b14-8+ |
| InChIKey | WCXDHFDTOYPNIE-RIYZIHGNSA-N |
| SMILES | C(/N(CC1=CC=C(Cl)N=C1)C)(=N\C#N)\C |
| LogP | 0.620 (est) |
| CAS DataBase Reference | 160430-64-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamiprid(160430-64-8) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/25-57 |
| Safety Statements | 45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | KJ4235200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Toxicity | LD50 in male, female rats, male, female mice (mg/kg): 217, 146, 198, 184 orally (Takahashi) |
| Uses | Insecticide. |
| Definition | ChEBI: A carboxamidine that is acetamidine in which the amino hydrogens are substituted by a (6-chloropyridin-3-yl)methyl and a methyl group while the hydrogen attached to the imino nitrogen is replaced by a cyano group. |
Acetamiprid Preparation Products And Raw materials
| Raw materials | Hexamethylenetetramine-->1-Bromobutane-->Acetamidine hydrochloride-->Ammonium bromide-->5-(Aminomethyl)-2-chloropyridine-->Dimethoxymethane |
