Introduction：Basic information about Amidosulfuron CAS 120923-37-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Amidosulfuron Basic informationDescription Toxicity
| Product Name: | Amidosulfuron |
| Synonyms: | AMIDOSULFURON;Amidosulfuron PESTANAL;GRATIL;n-(((((4,6-dimethoxy-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-n-methylmethanesulfonamide;METHYLMETHANESULFONAMIDE;1-(4,6-Dimethoxypyrimidin-2-yl)-3-(N-mesyl-N-methylsulfamoyl)urea;Amidosulfuron [iso];3,5-Dithia-2,4-diazahexanaMide,N-(4,6-diMethoxy-2-pyriMidinyl)-4-Methyl-, 3,3,5,5-tetraoxide |
| CAS: | 120923-37-7 |
| MF: | C9H15N5O7S2 |
| MW: | 369.37 |
| EINECS: | 407-380-0 |
| Product Categories: | |
| Mol File: | 120923-37-7.mol |
|
Amidosulfuron Chemical Properties
| Melting point | 160-163°C |
| density | 1.594±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 0.12±0.40(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic, Unstable in Solution |
| Major Application | agriculture
environmental |
| InChI | 1S/C9H15N5O7S2/c1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h5H,1-4H3,(H2,10,11,12,13,15) |
| InChIKey | CTTHWASMBLQOFR-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1 |
| LogP | 1.630 |
| CAS DataBase Reference | 120923-37-7(CAS DataBase Reference) |
Safety Information
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
Amidosulfuron Usage And Synthesis
| Description | Amidosulfuron is a broad spectrum herbicide that is used to control broad-leaved weeds. It is volatile, highly soluble in water and, based on its chemical properties, has a high potential for leaching to groundwater. It is not persistent in soil systems but may be persistent in water under certain conditions. |
| Toxicity | Amidosulfuron has a low mammalian toxicity and would not be expected to bioaccumulate. Amidosulfuron is moderately toxic to most terrestrial and aquatic species. |
| Uses | Herbicide. |
| Uses | Amidosulfuron, is used as pesticide and herbicides. |
| Definition | ChEBI: Amidosulfuron is an aromatic ether. |
| Metabolic pathway | The hydrolysis of 14C-amidosulfuron in buffer aqueoussolutions under various conditions results in 2-amino-4,6-dimethoxypyrimidine as the major hydrolyzedproduct. In soils, O-demethylated amidosulfuron is themajor degradation product. In mammals and plants,primary hydroxylation at the pyrimidine ring is acharacteristic degradation reaction yielding5-hydroxyamidosulfuron. |
Amidosulfuron Preparation Products And Raw materials
| Raw materials | Methanesulfonamide, N-(aminosulfonyl)-N-methyl--->4,6-Dimethoxy-2-(phenoxycarbonyl)aminopyrimidine-->2-Amino-4,6-dimethoxypyrimidine |
| Preparation Products | N-Methyl methanesulfonamide |
