Introduction:Basic information about Benzoylmetronildazole CAS 13182-89-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Benzoylmetronildazole Basic information
| Product Name: | Benzoylmetronildazole |
| Synonyms: | Benzoic acid [2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl] ester;2-(2-methyl-5-nitro-imidazol-1-yl)ethyl benzoate;2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate;benzoic acid 2-(2-methyl-5-nitro-imidazol-1-yl)ethyl ester;1-(2-Benzoyloxyethyl)-5-Nitro-2-Methyl-Imidazole;Metronidazole Benzoate (100 mg);1H-IMidazole-1-ethanol,2-Methyl-5-nitro-, 1-benzoate;benzoylmetronidazole |
| CAS: | 13182-89-3 |
| MF: | C13H13N3O4 |
| MW: | 275.26 |
| EINECS: | 236-131-7 |
| Product Categories: | Pharmaceutical intermediate;13182-89-3 |
| Mol File: | 13182-89-3.mol |
|
Benzoylmetronildazole Chemical Properties
| Melting point | 100 °C |
| Boiling point | 487.7±25.0 °C(Predicted) |
| density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Practically insoluble in water, freely soluble in methylene chloride, soluble in acetone, slightly soluble in alcohol. |
| pka | 2.44±0.34(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | InChI=1S/C13H13N3O4/c1-10-14-9-12(16(18)19)15(10)7-8-20-13(17)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | CUUCCLJJOWSASK-UHFFFAOYSA-N |
| SMILES | N1(CCOC(=O)C2C=CC=CC=2)C(C)=NC=C1[N+]([O-])=O |
| CAS DataBase Reference | 13182-89-3(CAS DataBase Reference) |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2933290000 |
| Storage Class | 11 - Combustible Solids |
Benzoylmetronildazole Usage And Synthesis
| Chemical Properties | White or slightly yellowish, crystalline powder or flakes. |
| Uses | Benzoylmetronildazole is a new class of antiglycation agents used to treat diabetes mellitus. Benzoylmetronildazole is also a derivative of Metronidazole (M338880), an antibacterial in the treatment of rosacea. |
| Uses | Anti-infective |
| Definition | ChEBI: A benzoate ester resulting from the formal condensation of benzoic acid with the hydroxy group of metronidazole. |
| Brand name | Flagyl (Searle); Metrogel (Galderma); Metrogel (3M Pharmaceuticals); Noritate(Sanofi Aventis); Vandazole (Teva). |
Benzoylmetronildazole Preparation Products And Raw materials