Introduction：Basic information about bis(2,3-epoxypropyl) adipate CAS 2754-17-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
bis(2,3-epoxypropyl) adipate Basic information
| Product Name: | bis(2,3-epoxypropyl) adipate |
| Synonyms: | bis(2,3-epoxypropyl) adipate;Adipic acid diglycidyl ester;Hexanedioic acid bis[(oxiran-2-yl)methyl] ester;Hexanedioic acid, 1,6-bis(2-oxiranylmethyl) ester |
| CAS: | 2754-17-8 |
| MF: | C12H18O6 |
| MW: | 258.27 |
| EINECS: | 220-403-7 |
| Product Categories: | |
| Mol File: | 2754-17-8.mol |
|
bis(2,3-epoxypropyl) adipate Chemical Properties
| Boiling point | 371.2±22.0 °C(Predicted) |
| density | 1.240±0.06 g/cm3(Predicted) |
| InChI | InChI=1S/C12H18O6/c13-11(17-7-9-5-15-9)3-1-2-4-12(14)18-8-10-6-16-10/h9-10H,1-8H2 |
| InChIKey | KBWLNCUTNDKMPN-UHFFFAOYSA-N |
| SMILES | C(OCC1CO1)(=O)CCCCC(OCC1CO1)=O |
| EPA Substance Registry System | Bis(2,3-epoxypropyl) adipate (2754-17-8) |
Safety Information
bis(2,3-epoxypropyl) adipate Usage And Synthesis
bis(2,3-epoxypropyl) adipate Preparation Products And Raw materials
