Introduction：Basic information about BIS(2-BUTOXYETHYL) ADIPATE CAS 141-18-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BIS(2-BUTOXYETHYL) ADIPATE Basic informationAcute toxicity
| Product Name: | BIS(2-BUTOXYETHYL) ADIPATE |
| Synonyms: | dibutylcellosolveadipate;Hexanedioic acid, bis(2-butoxyethyl) ester;Hexanedioicacid,bis(2-butoxyethyl)ester;ADIPIC ACID BIS(2-BUTOXYETHYL) ESTER;ADIPIC ACID DI(2-BUTOXYETHYL) ESTER;Adipic acid, bis(2-butyoxyethyl) ester;Adipic acid, bis(ethylene glycol monobutyl ether) ester;Adipic acid, dibutoxyethyl ester |
| CAS: | 141-18-4 |
| MF: | C18H34O6 |
| MW: | 346.46 |
| EINECS: | 205-466-0 |
| Product Categories: | Fatty Acid Esters (Plasticizer);Functional Materials;Plasticizer |
| Mol File: | 141-18-4.mol |
|
BIS(2-BUTOXYETHYL) ADIPATE Chemical Properties
| Melting point | -34 °C |
| Boiling point | 217 °C / 11mmHg |
| density | 1.00 |
| vapor pressure | 0.006Pa at 25℃ |
| refractive index | n20/D 1.444(lit.) |
| Fp | 199 °C |
| solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | 101mg/L at 20℃ |
| InChI | InChI=1S/C18H34O6/c1-3-5-11-21-13-15-23-17(19)9-7-8-10-18(20)24-16-14-22-12-6-4-2/h3-16H2,1-2H3 |
| InChIKey | IHTSDBYPAZEUOP-UHFFFAOYSA-N |
| SMILES | C(OCCOCCCC)(=O)CCCCC(OCCOCCCC)=O |
| LogP | 3.78 |
| CAS DataBase Reference | 141-18-4 |
| EPA Substance Registry System | Hexanedioic acid, bis(2-butoxyethyl) ester (141-18-4) |
Safety Information
| RTECS | AU8450000 |
| TSCA | TSCA listed |
| HS Code | 2917.12.5000 |
| Toxicity | LD50 ipr-rat: 600 mg/kg 14CYAT 2,1882,63 |
BIS(2-BUTOXYETHYL) ADIPATE Usage And Synthesis
| Acute toxicity | Intraperitoneal-rat LD50: 600 mg/kg |
| Physical properties | Bis(2-butoxyethyl) Adipate is a liquid, with a density of 0.997 and a boiling point of208°C (at 4 mmHg). |
| Uses | Dibutoxyethyl adipate is used as a plasticizer for polyvinylchloride and polyvinyl chloride–acetate copolymers. |
| Safety Profile | Moderately toxic byintraperitoneal route. When heated todecomposition it emits acrid smoke and irritating fumes. |
BIS(2-BUTOXYETHYL) ADIPATE Preparation Products And Raw materials
