Introduction：Basic information about Boc-4-Bromo-D-beta-phenylalanine CAS 261165-06-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Boc-4-Bromo-D-beta-phenylalanine Basic information
| Product Name: | Boc-4-Bromo-D-beta-phenylalanine |
| Synonyms: | Boc-beta-(S)-4-bromophenylalanine;(S)-N-Boc-3-amino-3-(4-bromophenyl)propanoicacid(e.e.);(s)-boc-4-bromo-β-phe-oh;(3S)-3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;(S)-3-(4-BROMO-PHENYL)-3-TERT-BUTOXYCARBONYLAMINO-PROPIONIC ACID;Boc-b-Phe(4-Br)-OH;BOC-(S)-4-SS-BROMOPHENYLALANINE;(S)-3-(Boc-amino)-3-(4-bromophenyl)propionic acid, Boc-4-bromo-D-β-phenylalanine |
| CAS: | 261165-06-4 |
| MF: | C14H18BrNO4 |
| MW: | 344.2 |
| EINECS: | |
| Product Categories: | B-Amino;3-Amino-3-phenylpropionic Acid Analogs;3-Amino-3-phenylpropanoic Acid Analogs |
| Mol File: | 261165-06-4.mol |
|
Boc-4-Bromo-D-beta-phenylalanine Chemical Properties
| Melting point | 143.8 °C |
| Boiling point | 479.1±40.0 °C(Predicted) |
| density | 1.5311 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | 2-8°C |
| pka | 4.27±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Optical Rotation | [α]/D -46.0±2.0°, c = 1 in ethanol |
| InChI | InChI=1/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(8-12(17)18)9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/s3 |
| InChIKey | ZAMLGGRVTAXBHI-LBPXTSNRNA-N |
| SMILES | [C@@H](CC(=O)O)(NC(=O)OC(C)(C)C)C1=CC=C(Br)C=C1 |&1:0,r| |
| CAS DataBase Reference | 261165-06-4(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29223900 |
Boc-4-Bromo-D-beta-phenylalanine Usage And Synthesis
| Chemical Properties | white to off-white powder |
| Uses | (S)-3-(4-Bromophenyl)-3-((tert-butoxycarbonyl)amino)propanoic acid is a phenylalanine derivative[1]. |
| References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-808. DOI:10.1080/10408398.2012.708368 |
Boc-4-Bromo-D-beta-phenylalanine Preparation Products And Raw materials
