Introduction:Basic information about BroMocriptine IMpurity E CAS 2492-53-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BroMocriptine IMpurity E Basic information
| Product Name: | BroMocriptine IMpurity E |
| Synonyms: | BroMocriptine IMpurity E;Bromocriptine EP Impurity E;Bromocriptine Impurity 5(Bromocriptine Mesylate EP Impurity E);(6aR,9R)-5-Bromo-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide;Bromocriptine Mesylate EP Impurity E;Ergoline-8-carboxamide, 2-bromo-9,10-didehydro-6-methyl-, (8β)- (9CI) |
| CAS: | 2492-53-7 |
| MF: | C16H16BrN3O |
| MW: | 346.22 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2492-53-7.mol |
|
BroMocriptine IMpurity E Chemical Properties
| Melting point | 215-217 °C(Solv: chloroform (67-66-3)) |
| Boiling point | 613.8±55.0 °C(Predicted) |
| density | 1.63±0.1 g/cm3(Predicted) |
| pka | 15.62±0.40(Predicted) |
| InChI | InChI=1/C32H40BrN5O5/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39)/t18-,23-,24+,25+,31-,32+/s3 |
| InChIKey | OZVBMTJYIDMWIL-CCCBMRMVNA-N |
| SMILES | C1[C@@H](C(N[C@@]2(O[C@@]3(N([C@H](C(N4[C@@]3([H])CCC4)=O)CC(C)C)C2=O)O)C(C)C)=O)CN(C)[C@]2(C=1C1=C3C(C2)=C(Br)NC3=CC=C1)[H] |&1:1,4,6,8,11,31,r| |
Safety Information
BroMocriptine IMpurity E Usage And Synthesis
| Uses | 2-Bromolysergamide and other Lysergic Acid derivatives are ergopeptides that interact with liver cytochromes P 450. They have also been known to irreversibly inhibit serotonin containing neurons of the raphe nuclei. |
BroMocriptine IMpurity E Preparation Products And Raw materials