Bromotris(dimethylamino)phosphonium hexafluorophosphate CAS 50296-37-2
Introduction：Basic information about Bromotris(dimethylamino)phosphonium hexafluorophosphate CAS 50296-37-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bromotris(dimethylamino)phosphonium hexafluorophosphate Basic information
| Product Name: | Bromotris(dimethylamino)phosphonium hexafluorophosphate |
| Synonyms: | BROMOTRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE;BROP;Bromotris(dimethylamino)phosphoniumHexafluorophos;BROMO-TRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE (BROP);BROP BROMOTRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE;Bromotris(dimethylamino)phosphonium hexafluorophosphate, 98+% (AT);Bromotris(dimethylamino)phosphonium hexafluorophosphate, 98+%;bromotris(dimethylamino)phosphonium hexafluorophosphate(V) |
| CAS: | 50296-37-2 |
| MF: | C6H18BrF6N3P2 |
| MW: | 388.07 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 50296-37-2.mol |
Bromotris(dimethylamino)phosphonium hexafluorophosphate Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H18BrN3P.F6P/c1-8(2)11(7,9(3)4)10(5)6;1-7(2,3,4,5)6/h1-6H3;/q+1;-1 |
| InChIKey | XELPBWPBGHCIKX-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[P+](Br)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 50296-37-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-34 |
| Safety Statements | 53-26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29299090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Skin Corr. 1B |
| Chemical Properties | White to off-white powder |
| Uses | Reagent for: Conjugate addition of nitroalkanes to an acrylate equivalent A novel polymer supported approach to nucleoside modification Asymmetric hydrogenations Peptide coupling Pyrrolidine hydroxylation Synthesis of cyclic PNA-based compound directed against HIV-1 TAR RNA |
| reaction suitability | reaction type: Coupling Reactions |
Bromotris(dimethylamino)phosphonium hexafluorophosphate Preparation Products And Raw materials
