Introduction：Basic information about Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester CAS 121505-13-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Basic information
| Product Name: | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester |
| Synonyms: | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester;DK495;3-trimethoxysilylpropyl 3-oxobutanoate |
| CAS: | 121505-13-3 |
| MF: | C10H20O6Si |
| MW: | 264.3477 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 121505-13-3.mol |
|
Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Chemical Properties
| Boiling point | 284.2±20.0 °C(Predicted) |
| density | 1.061±0.06 g/cm3(Predicted) |
| pka | 10?+-.0.46(Predicted) |
| InChI | InChI=1S/C10H20O6Si/c1-9(11)8-10(12)16-6-5-7-17(13-2,14-3)15-4/h5-8H2,1-4H3 |
| InChIKey | JLZKEFNAFBDTIM-UHFFFAOYSA-N |
| SMILES | C(OCCC[Si](OC)(OC)OC)(=O)CC(=O)C |
Safety Information
Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Usage And Synthesis
| Uses | Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester is used for polarizing plates, polarizing plates and optical display device films. |
Butanoic acid, 3-oxo-, 3-(trimethoxysilyl)propyl ester Preparation Products And Raw materials
