Introduction：Basic information about Butynediol sulfopropyl ether sodium CAS 90268-78-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Butynediol sulfopropyl ether sodium Basic information
| Product Name: | Butynediol sulfopropyl ether sodium |
| Synonyms: | 3-(Butynediol)-sulfopropyl ether monosodium salt;butynediol sulfopropyl ether sodium;HBOPS-NA;2-BUTYNE-1,4-DIOL-(3-SULFOPROPYL) ETHER SODIUM SALT;Sulfopropylated 2 Butyne-1,4-diol, sodium -salt;2-Butyne-1,4-diol, reaction products with 1,2-oxathiolane 2,2-dioxide and sodium hydroxide;2-Butyne-1,4-diol-(3-sulfopropyl)ether;3-(2-butyne-1-ol)-sulfopropyl ether, sodium salt |
| CAS: | 90268-78-3 |
| MF: | C7H12NaO5S |
| MW: | 231.22 |
| EINECS: | 290-883-0 |
| Product Categories: | |
| Mol File: | 90268-78-3.mol |
|
Butynediol sulfopropyl ether sodium Chemical Properties
| density | 1.5g/cm3 at 20℃ |
| vapor pressure | 0-0.331Pa at 25℃ |
| form | Solid:particulate/powder |
| InChI | InChI=1S/C7H12O5S.Na/c8-4-1-2-5-12-6-3-7-13(9,10)11;/h8H,3-7H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | IGRGEBBXERSCPC-UHFFFAOYSA-M |
| SMILES | C(S([O-])(=O)=O)CCOCC#CCO.[Na+] |
| LogP | -5.49--0.93 |
| Surface tension | 72.06-72.62mN/m at 1g/L and 22.3℃ |
Safety Information
Butynediol sulfopropyl ether sodium Usage And Synthesis
Butynediol sulfopropyl ether sodium Preparation Products And Raw materials
