Introduction：Basic information about Calcium bis(2-hydroxy-4-(methylthio)butyrate) CAS 4857-44-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Calcium bis(2-hydroxy-4-(methylthio)butyrate) Basic information
| Product Name: | Calcium bis(2-hydroxy-4-(methylthio)butyrate) |
| Synonyms: | dl-methioninehydroxyanalogcalcium;2-HYDROXY-4-(METHYLTHIO)BUTYRIC ACID CALCIUM SALT;2-hydroxy-4-(methylthio)-butanoicacicalciumsalt(2:1);2-hydroxy-4-(methylthio)butanoicacidcalciumsalt;2-hydroxy-4-(methylthio)-butyricacicalciumsalt(2:1);alcium bis(2-hydroxy-4-(methylthio)butyrate;ALPHA-HYDROXY-DL-METHIONINE CALCIUM SALT;BUTANOIC ACID, 2-HYDROXY-4-(METHYLTHIO)-, CALCIUM SALT (2:1) |
| CAS: | 4857-44-7 |
| MF: | C5H12CaO3S |
| MW: | 192.29 |
| EINECS: | 225-455-4 |
| Product Categories: | Ca (Calcium) Compounds;Classes of Metal Compounds;Typical Metal Compounds;1 |
| Mol File: | 4857-44-7.mol |
|
Calcium bis(2-hydroxy-4-(methylthio)butyrate) Chemical Properties
| Melting point | >270°C (dec.) |
| storage temp. | 2-8°C |
| solubility | Water (Sparingly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,5976 |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/2C5H10O3S.Ca/c2*1-9-3-2-4(6)5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | ABRVDWASZFDIEH-UHFFFAOYSA-L |
| SMILES | CSCCC(O)C(=O)O[Ca]OC(=O)C(O)CCSC |
| CAS DataBase Reference | 4857-44-7(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | ET4731600 |
| F | 3-8-10 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in rat: 12870mg/kg |
Calcium bis(2-hydroxy-4-(methylthio)butyrate) Usage And Synthesis
| Uses | Calcium α-Hydroxy-γ-Methylmercaptobutyrate is useful in ion pairing inside Mammals and is therefore useful when it comes to nitrogen retention allowing for animal to grow quickly. |
Calcium bis(2-hydroxy-4-(methylthio)butyrate) Preparation Products And Raw materials
| Raw materials | Calcium hydroxide-->2-HYDROXY-4-(METHYLTHIO)BUTYRIC ACID |
